The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-[4-[(1-bromo-2-naphthyl)oxy]-3-chloro-phenyl]-2-hydroxy-4-(trifluoromethyl)benzamide ID: ALA4795291
PubChem CID: 162672673
Max Phase: Preclinical
Molecular Formula: C24H14BrClF3NO3
Molecular Weight: 536.73
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(Nc1ccc(Oc2ccc3ccccc3c2Br)c(Cl)c1)c1ccc(C(F)(F)F)cc1O
Standard InChI: InChI=1S/C24H14BrClF3NO3/c25-22-16-4-2-1-3-13(16)5-9-21(22)33-20-10-7-15(12-18(20)26)30-23(32)17-8-6-14(11-19(17)31)24(27,28)29/h1-12,31H,(H,30,32)
Standard InChI Key: KWOIKIFRJYDRCS-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
4.1935 -5.1763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9017 -4.7614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8970 -3.9351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1879 -3.5318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6152 -5.1713 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.3254 -4.7559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0360 -5.1703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7458 -4.7555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7430 -3.9333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0246 -3.5276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3178 -3.9406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0364 -5.9916 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
8.4527 -3.5210 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.1667 -3.9259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8764 -3.5136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1709 -4.7472 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.5846 -3.9207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2938 -3.5091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2900 -2.6869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5711 -2.2781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8689 -2.6961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4780 -4.7631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4834 -3.9443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7809 -3.5325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0685 -3.9350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0631 -4.7538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7701 -5.1701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1960 -5.9935 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
10.5863 -4.7379 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.9954 -2.2744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7054 -2.6790 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
11.9909 -1.4572 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
12.6995 -1.8614 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
22 1 1 0
1 2 2 0
2 3 1 0
3 4 2 0
4 23 1 0
2 5 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 6 1 0
7 12 1 0
9 13 1 0
13 14 1 0
14 15 1 0
14 16 2 0
15 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 15 1 0
22 23 2 0
22 27 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
1 28 1 0
17 29 1 0
19 30 1 0
30 31 1 0
30 32 1 0
30 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 536.73Molecular Weight (Monoisotopic): 534.9798AlogP: 8.02#Rotatable Bonds: 4Polar Surface Area: 58.56Molecular Species: NEUTRALHBA: 3HBD: 2#RO5 Violations: 2HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 7.47CX Basic pKa: ┄CX LogP: 7.50CX LogD: 7.24Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.28Np Likeness Score: -1.13
References 1. Fujii S,Kikuchi E,Watanabe Y,Suzuyama H,Ishigami-Yuasa M,Mori T,Isobe K,Uchida S,Kagechika H. (2020) Structural development of N-(4-phenoxyphenyl)benzamide derivatives as novel SPAK inhibitors blocking WNK kinase signaling., 30 (17): [PMID:32738993 ] [10.1016/j.bmcl.2020.127408 ]