The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(Z)-5-((5-(2-Acetamidoethyl)-2-oxoindolin-3-ylidene)methyl)-N-(2-(diethylamino)ethyl)-2,4-dimethyl-1H-pyrrole-3-carboxamide ID: ALA4795330
PubChem CID: 162673814
Max Phase: Preclinical
Molecular Formula: C26H35N5O3
Molecular Weight: 465.60
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCN(CC)CCNC(=O)c1c(C)[nH]c(/C=C2\C(=O)Nc3ccc(CCNC(C)=O)cc32)c1C
Standard InChI: InChI=1S/C26H35N5O3/c1-6-31(7-2)13-12-28-26(34)24-16(3)23(29-17(24)4)15-21-20-14-19(10-11-27-18(5)32)8-9-22(20)30-25(21)33/h8-9,14-15,29H,6-7,10-13H2,1-5H3,(H,27,32)(H,28,34)(H,30,33)/b21-15-
Standard InChI Key: BZYRCHBRDGOULK-QNGOZBTKSA-N
Molfile:
RDKit 2D
34 36 0 0 0 0 0 0 0 0999 V2000
25.5023 -11.5415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5012 -12.3688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2159 -12.7817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2142 -11.1287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9296 -11.5378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9298 -12.3689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7202 -12.6254 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.2085 -11.9529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7198 -11.2808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9745 -10.4962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0335 -11.9526 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.7821 -10.3259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3337 -10.9372 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.0856 -10.6016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9986 -9.7827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1930 -9.6124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8568 -8.8591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6112 -9.2300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3961 -9.4842 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.4388 -8.4233 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.8004 -11.0135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0085 -8.9315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7935 -9.1856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.4059 -8.6330 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.1909 -8.8871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8033 -8.3345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2336 -7.8261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8461 -7.2735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7844 -11.1273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7840 -10.3023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4983 -9.8895 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.4979 -9.0645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2123 -8.6517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7833 -8.6524 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 5 1 0
9 10 2 0
10 12 1 0
8 11 2 0
12 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 12 2 0
16 17 1 0
15 18 1 0
18 19 1 0
18 20 2 0
14 21 1 0
19 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
24 27 1 0
27 28 1 0
1 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
32 34 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 465.60Molecular Weight (Monoisotopic): 465.2740AlogP: 2.87#Rotatable Bonds: 10Polar Surface Area: 106.33Molecular Species: BASEHBA: 4HBD: 4#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.28CX Basic pKa: 9.04CX LogP: 2.02CX LogD: 0.37Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.40Np Likeness Score: -0.78
References 1. Matheson CJ,Casalvieri KA,Backos DS,Minhajuddin M,Jordan CT,Reigan P. (2020) Substituted oxindol-3-ylidenes as AMP-activated protein kinase (AMPK) inhibitors., 197 [PMID:32334266 ] [10.1016/j.ejmech.2020.112316 ]