2-Amino-N-((R)-carbamoylphenylmethyl)-N-((R)-6-chloro-4-fluoroindan-1-yl)nicotinamide

ID: ALA4795385

PubChem CID: 87055788

Max Phase: Preclinical

Molecular Formula: C23H20ClFN4O2

Molecular Weight: 438.89

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  NC(=O)[C@@H](c1ccccc1)N(C(=O)c1cccnc1N)[C@@H]1CCc2c(F)cc(Cl)cc21

Standard InChI:  InChI=1S/C23H20ClFN4O2/c24-14-11-17-15(18(25)12-14)8-9-19(17)29(23(31)16-7-4-10-28-21(16)26)20(22(27)30)13-5-2-1-3-6-13/h1-7,10-12,19-20H,8-9H2,(H2,26,28)(H2,27,30)/t19-,20-/m1/s1

Standard InChI Key:  UQWXSZBNADPSOU-WOJBJXKFSA-N

Molfile:  

 
     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
   43.4129   -1.4527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.4118   -2.2764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.1239   -2.6895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.8377   -2.2759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.8349   -1.4491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.1221   -1.0439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.1237   -3.5108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.4118   -3.9192    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   44.8355   -3.9196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.5474   -3.5112    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   44.8353   -4.7409    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   42.7001   -3.5105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.4116   -4.7406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.6997   -5.1531    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   43.9921   -5.3200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.7792   -6.1113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.3548   -6.6863    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   45.1463   -6.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.3549   -5.6793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.7778   -5.1077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.6103   -2.6990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.8071   -2.5302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.9490   -3.8505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.4014   -3.2444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.6047   -3.4161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.3544   -4.1935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.9071   -4.7993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.7017   -4.6244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.0561   -2.8104    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   40.6599   -5.5782    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   42.9898   -6.3226    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  3  1  6
  7  8  1  0
  7  9  1  0
  9 10  1  0
  9 11  2  0
 12  8  1  1
  8 13  1  0
 13 14  2  0
 13 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 12 21  1  0
 21 22  1  0
 22 24  1  0
 23 12  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
 25 29  1  0
 27 30  1  0
 16 31  1  0
M  END

Associated Targets(Human)

TRPM8 Tclin Transient receptor potential cation channel subfamily M member 8 (1168 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CYP3A4 Tclin Cytochrome P450 3A4 (53859 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 438.89Molecular Weight (Monoisotopic): 438.1259AlogP: 3.81#Rotatable Bonds: 5
Polar Surface Area: 102.31Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 5.48CX LogP: 4.09CX LogD: 4.09
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.63Np Likeness Score: -1.13

References

1. Kobayashi JI,Hirasawa H,Fujimori Y,Nakanishi O,Kamada N,Ikeda T,Yamamoto A,Kanbe H.  (2021)  Identification of N-acyl-N-indanyl-α-phenylglycinamides as selective TRPM8 antagonists designed to mitigate the risk of adverse effects.,  30  [PMID:33333445] [10.1016/j.bmc.2020.115903]

Source