The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(4-benzylpiperazin-l-y1)-2-{4-[(quinazolin-4-ylamino)methyl]-1H-1,2,3-triazol-1-yl}ethan-l-one ID: ALA4795453
PubChem CID: 162672788
Max Phase: Preclinical
Molecular Formula: C24H26N8O
Molecular Weight: 442.53
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(Cn1cc(CNc2ncnc3ccccc23)nn1)N1CCN(Cc2ccccc2)CC1
Standard InChI: InChI=1S/C24H26N8O/c33-23(31-12-10-30(11-13-31)15-19-6-2-1-3-7-19)17-32-16-20(28-29-32)14-25-24-21-8-4-5-9-22(21)26-18-27-24/h1-9,16,18H,10-15,17H2,(H,25,26,27)
Standard InChI Key: IXQAHRJHYMCQAT-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 37 0 0 0 0 0 0 0 0999 V2000
18.4569 -16.1746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2741 -16.1746 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.5285 -15.3979 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.8655 -14.9158 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.2068 -15.3979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7537 -16.8363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5665 -16.7518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0461 -17.4135 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.8998 -16.0057 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.7096 -18.1584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1855 -18.8183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9991 -18.7380 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.3346 -17.9918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8564 -17.3259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4762 -19.4015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2893 -19.3201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7649 -19.9853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5774 -19.9043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9142 -19.1588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4325 -18.4934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6218 -18.5777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4295 -15.1458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8224 -15.6928 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.0451 -15.4407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4955 -14.9350 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.6693 -15.7378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4455 -15.9864 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.1035 -14.3877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8774 -14.6401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4809 -14.0967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3118 -13.3007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5338 -13.0510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9336 -13.5961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 1 2 0
2 6 1 0
6 7 1 0
7 8 1 0
7 9 2 0
8 10 1 0
8 14 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
12 15 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
5 22 1 0
22 23 1 0
23 24 1 0
24 29 2 0
28 25 2 0
25 26 1 0
26 27 2 0
27 24 1 0
28 29 1 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 442.53Molecular Weight (Monoisotopic): 442.2230AlogP: 2.18#Rotatable Bonds: 7Polar Surface Area: 92.07Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 6.94CX LogP: 2.04CX LogD: 1.91Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.47Np Likeness Score: -1.95
References 1. Dos Santos DF,de Pilger DRB,Vandermeulen C,Khouri R,Mantoani SP,Nunes PSG,de Andrade P,Carvalho I,Casseb J,Twizere JC,Willems L,Freitas-Junior L,Kashima S. (2020) Non-cytotoxic 1,2,3-triazole tethered fused heterocyclic ring derivatives display Tax protein inhibition and impair HTLV-1 infected cells., 28 (22): [PMID:33007558 ] [10.1016/j.bmc.2020.115746 ]