1-(4-benzylpiperazin-l-y1)-2-{4-[(quinazolin-4-ylamino)methyl]-1H-1,2,3-triazol-1-yl}ethan-l-one

ID: ALA4795453

PubChem CID: 162672788

Max Phase: Preclinical

Molecular Formula: C24H26N8O

Molecular Weight: 442.53

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(Cn1cc(CNc2ncnc3ccccc23)nn1)N1CCN(Cc2ccccc2)CC1

Standard InChI:  InChI=1S/C24H26N8O/c33-23(31-12-10-30(11-13-31)15-19-6-2-1-3-7-19)17-32-16-20(28-29-32)14-25-24-21-8-4-5-9-22(21)26-18-27-24/h1-9,16,18H,10-15,17H2,(H,25,26,27)

Standard InChI Key:  IXQAHRJHYMCQAT-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 37  0  0  0  0  0  0  0  0999 V2000
   18.4569  -16.1746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2741  -16.1746    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.5285  -15.3979    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.8655  -14.9158    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.2068  -15.3979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7537  -16.8363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5665  -16.7518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0461  -17.4135    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.8998  -16.0057    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.7096  -18.1584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1855  -18.8183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9991  -18.7380    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.3346  -17.9918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8564  -17.3259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4762  -19.4015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2893  -19.3201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7649  -19.9853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5774  -19.9043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9142  -19.1588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4325  -18.4934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6218  -18.5777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4295  -15.1458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8224  -15.6928    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.0451  -15.4407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4955  -14.9350    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.6693  -15.7378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4455  -15.9864    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.1035  -14.3877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8774  -14.6401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4809  -14.0967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3118  -13.3007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5338  -13.0510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9336  -13.5961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  1  2  0
  2  6  1  0
  6  7  1  0
  7  8  1  0
  7  9  2  0
  8 10  1  0
  8 14  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 12 15  1  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
  5 22  1  0
 22 23  1  0
 23 24  1  0
 24 29  2  0
 28 25  2  0
 25 26  1  0
 26 27  2  0
 27 24  1  0
 28 29  1  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 28  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4795453

    ---

Associated Targets(Human)

MT2 (2907 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 442.53Molecular Weight (Monoisotopic): 442.2230AlogP: 2.18#Rotatable Bonds: 7
Polar Surface Area: 92.07Molecular Species: NEUTRALHBA: 8HBD: 1
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 6.94CX LogP: 2.04CX LogD: 1.91
Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.47Np Likeness Score: -1.95

References

1. Dos Santos DF,de Pilger DRB,Vandermeulen C,Khouri R,Mantoani SP,Nunes PSG,de Andrade P,Carvalho I,Casseb J,Twizere JC,Willems L,Freitas-Junior L,Kashima S.  (2020)  Non-cytotoxic 1,2,3-triazole tethered fused heterocyclic ring derivatives display Tax protein inhibition and impair HTLV-1 infected cells.,  28  (22): [PMID:33007558] [10.1016/j.bmc.2020.115746]

Source