2-((5-methoxybenzofuran-2-yl)(phenyl)methyl)-3-methyl-1H-indole

ID: ALA4795476

PubChem CID: 162672917

Max Phase: Preclinical

Molecular Formula: C25H21NO2

Molecular Weight: 367.45

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc2oc(C(c3ccccc3)c3[nH]c4ccccc4c3C)cc2c1

Standard InChI:  InChI=1S/C25H21NO2/c1-16-20-10-6-7-11-21(20)26-25(16)24(17-8-4-3-5-9-17)23-15-18-14-19(27-2)12-13-22(18)28-23/h3-15,24,26H,1-2H3

Standard InChI Key:  PAPVUHNBMXTFLM-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 28 32  0  0  0  0  0  0  0  0999 V2000
   25.5750  -19.5424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5739  -20.3619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2819  -20.7709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2801  -19.1335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9887  -19.5388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9935  -20.3574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7736  -20.6059    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.2509  -19.9407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7658  -19.2813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0681  -19.9359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4809  -20.6412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4725  -19.2258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0739  -21.3500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4860  -22.0548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3041  -22.0505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7083  -21.3354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2939  -20.6335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2845  -19.1343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1356  -18.4800    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.7396  -17.9295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4466  -18.3341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1484  -17.9241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1443  -17.1097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4326  -16.7071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7338  -17.1194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8365  -19.7369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8672  -19.1340    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.8670  -18.3168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
  8 10  1  0
 10 11  1  0
 10 12  1  0
 11 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 11  1  0
 12 18  2  0
 18 21  1  0
 20 19  1  0
 19 12  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 18 26  1  0
  1 27  1  0
 27 28  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4795476

    ---

Associated Targets(Human)

SiHa (2051 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 367.45Molecular Weight (Monoisotopic): 367.1572AlogP: 6.41#Rotatable Bonds: 4
Polar Surface Area: 38.16Molecular Species: NEUTRALHBA: 2HBD: 1
#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 5.75CX LogD: 5.75
Aromatic Rings: 5Heavy Atoms: 28QED Weighted: 0.40Np Likeness Score: -0.09

References

1. Siddiqui SK,SahayaSheela VJ,Kolluru S,Pandian GN,Santhoshkumar TR,Dan VM,Ramana CV.  (2020)  Discovery of 3-(benzofuran-2-ylmethyl)-1H-indole derivatives as potential autophagy inducers in cervical cancer cells.,  30  (19): [PMID:32769048] [10.1016/j.bmcl.2020.127431]

Source