N-(4-amino-3-(trifluoromethyl)phenyl)-4-chlorobenzenesulfonamide

ID: ALA4795755

PubChem CID: 162673626

Max Phase: Preclinical

Molecular Formula: C13H10ClF3N2O2S

Molecular Weight: 350.75

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Nc1ccc(NS(=O)(=O)c2ccc(Cl)cc2)cc1C(F)(F)F

Standard InChI:  InChI=1S/C13H10ClF3N2O2S/c14-8-1-4-10(5-2-8)22(20,21)19-9-3-6-12(18)11(7-9)13(15,16)17/h1-7,19H,18H2

Standard InChI Key:  KTJFMJRAYXBLOZ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 22 23  0  0  0  0  0  0  0  0999 V2000
   14.2018  -15.5803    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.7973  -14.8745    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   13.3884  -15.5777    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.2157  -14.8745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2145  -15.6940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9226  -16.1030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6322  -15.6936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6294  -14.8709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9208  -14.4656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5079  -14.4661    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.0924  -14.4664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0959  -13.6486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3889  -13.2403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6803  -13.6491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6832  -14.4705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3907  -14.8752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3406  -16.1010    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.9224  -16.9202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2146  -17.3286    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   16.6300  -17.3290    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   15.9146  -17.7347    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   10.9720  -13.2416    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
  4 10  1  0
 10  2  1  0
  2 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
  7 17  1  0
  6 18  1  0
 18 19  1  0
 18 20  1  0
 18 21  1  0
 14 22  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4795755

    ---

Associated Targets(Human)

FFAR4 Tchem G-protein coupled receptor 120 (2999 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
FFAR1 Tchem Free fatty acid receptor 1 (4763 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 350.75Molecular Weight (Monoisotopic): 350.0104AlogP: 3.74#Rotatable Bonds: 3
Polar Surface Area: 72.19Molecular Species: NEUTRALHBA: 3HBD: 2
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 8.26CX Basic pKa: 2.31CX LogP: 3.11CX LogD: 3.06
Aromatic Rings: 2Heavy Atoms: 22QED Weighted: 0.83Np Likeness Score: -1.82

References

1. Xu F,Zhao Y,Zhou H,Li C,Zhang X,Hou T,Qu L,Wei L,Wang J,Liu Y,Liang X.  (2020)  Synthesis and evaluation of 3-(4-(phenoxymethyl)phenyl)propanoic acid and N-phenylbenzenesulfonamide derivatives as FFA4 agonists.,  30  (24): [PMID:33127539] [10.1016/j.bmcl.2020.127650]

Source