The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Callicarpin E ID: ALA4795801
PubChem CID: 162674386
Max Phase: Preclinical
Molecular Formula: C20H30O7
Molecular Weight: 382.45
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C[C@@H]1CC[C@]2(C)[C@H](C[C@H](C(=O)O)[C@]2(C)O)[C@@]1(C)C[C@H](O)C1=CC(=O)OC1O
Standard InChI: InChI=1S/C20H30O7/c1-10-5-6-19(3)14(8-12(16(23)24)20(19,4)26)18(10,2)9-13(21)11-7-15(22)27-17(11)25/h7,10,12-14,17,21,25-26H,5-6,8-9H2,1-4H3,(H,23,24)/t10-,12-,13+,14-,17?,18+,19-,20+/m1/s1
Standard InChI Key: GMZBFSZCHUFEQU-MBOAGORKSA-N
Molfile:
RDKit 2D
28 30 0 0 0 0 0 0 0 0999 V2000
20.4215 -12.9389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4257 -13.7561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1313 -13.3439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4293 -15.3904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1346 -14.9860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1346 -14.1688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7240 -14.9860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7195 -14.1688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9410 -13.9206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4643 -14.5843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9483 -15.2427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1272 -12.5267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1230 -11.7095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8369 -12.9317 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.7778 -11.2280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5213 -10.4521 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.7041 -10.4562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4556 -11.2347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2204 -9.7976 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.5563 -11.4763 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.8430 -13.7615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7199 -15.8032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5012 -13.3763 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
17.6471 -14.5889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2346 -13.8834 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.2424 -15.2988 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.2382 -15.6463 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.9440 -16.0590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
2 3 1 6
8 2 1 0
7 4 1 0
4 5 1 0
5 6 1 0
6 2 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 7 1 0
1 12 1 0
12 13 1 0
12 14 1 1
13 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 13 2 0
17 19 2 0
15 20 1 0
6 21 1 6
7 22 1 6
8 23 1 1
10 24 1 1
24 25 1 0
24 26 2 0
11 27 1 0
11 28 1 6
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 382.45Molecular Weight (Monoisotopic): 382.1992AlogP: 1.45#Rotatable Bonds: 4Polar Surface Area: 124.29Molecular Species: ACIDHBA: 6HBD: 4#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 4.34CX Basic pKa: ┄CX LogP: 1.55CX LogD: -3.18Aromatic Rings: ┄Heavy Atoms: 27QED Weighted: 0.54Np Likeness Score: 3.04
References 1. Pu DB,Zhang XJ,Bi DW,Gao JB,Yang Y,Li XL,Lin J,Li XN,Zhang RH,Xiao WL. (2020) Callicarpins, Two Classes of Rearranged ent-Clerodane Diterpenoids from Callicarpa Plants Blocking NLRP3 Inflammasome-Induced Pyroptosis., 83 (7.0): [PMID:32628479 ] [10.1021/acs.jnatprod.0c00288 ]