The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(10-Furan-3-yl-11-oxo-10,11-dihydro-5-oxa-4,10-diaza-dibenzo[a,d]cyclohepten-7-yl)-3-phenyl-urea ID: ALA4796082
PubChem CID: 162673866
Max Phase: Preclinical
Molecular Formula: C23H16N4O4
Molecular Weight: 412.41
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(Nc1ccccc1)Nc1ccc2c(c1)Oc1ncccc1C(=O)N2c1ccoc1
Standard InChI: InChI=1S/C23H16N4O4/c28-22-18-7-4-11-24-21(18)31-20-13-16(26-23(29)25-15-5-2-1-3-6-15)8-9-19(20)27(22)17-10-12-30-14-17/h1-14H,(H2,25,26,29)
Standard InChI Key: WDAJBXDNCGOTFY-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 35 0 0 0 0 0 0 0 0999 V2000
16.2765 -21.8653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0568 -22.0553 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.0806 -20.2560 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.6770 -21.5580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6787 -20.7307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3920 -20.3209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1081 -20.7337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1065 -21.5609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3886 -21.9754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3178 -20.4273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9487 -21.1130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1747 -21.1361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7639 -20.4753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1329 -19.7896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9128 -19.7648 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.7453 -22.4967 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.8230 -20.3216 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.5373 -20.7347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2521 -20.3226 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.5367 -21.5598 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.2509 -21.9727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2358 -22.8627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9919 -23.1963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9127 -24.0194 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.1053 -24.1984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6857 -23.4858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9623 -21.5565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6760 -21.9689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6759 -22.7948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9560 -23.2068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2452 -22.7921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 11 1 0
1 2 1 0
5 3 1 0
3 10 1 0
2 4 1 0
4 5 1 0
4 9 2 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
10 11 1 0
10 15 2 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
1 16 2 0
7 17 1 0
17 18 1 0
18 19 2 0
18 20 1 0
20 21 1 0
2 22 1 0
22 23 2 0
23 24 1 0
24 25 1 0
25 26 2 0
26 22 1 0
21 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 21 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 412.41Molecular Weight (Monoisotopic): 412.1172AlogP: 5.40#Rotatable Bonds: 3Polar Surface Area: 96.70Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.38CX Basic pKa: 1.52CX LogP: 3.78CX LogD: 3.78Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.47Np Likeness Score: -1.16
References 1. Martínez-González S,García AB,Albarrán MI,Cebriá A,Amezquita-Alves A,García-Campos FJ,Martínez-Gago J,Martínez-Torrecuadrada J,Muñoz IG,Blanco-Aparicio C,Pastor J. (2020) Pyrido[2,3-b][1,5]benzoxazepin-5(6H)-one derivatives as CDK8 inhibitors., 201 [PMID:32599324 ] [10.1016/j.ejmech.2020.112443 ]