(10-(2-hydroxybenzoyloxy)decyl)triphenylphosphonium bromide

ID: ALA4796140

PubChem CID: 162674259

Max Phase: Preclinical

Molecular Formula: C35H40BrO3P

Molecular Weight: 539.68

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(OCCCCCCCCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1)c1ccccc1O.[Br-]

Standard InChI:  InChI=1S/C35H39O3P.BrH/c36-34-27-17-16-26-33(34)35(37)38-28-18-5-3-1-2-4-6-19-29-39(30-20-10-7-11-21-30,31-22-12-8-13-23-31)32-24-14-9-15-25-32;/h7-17,20-27H,1-6,18-19,28-29H2;1H

Standard InChI Key:  DPWRIVFIUYZYAZ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 40 42  0  0  0  0  0  0  0  0999 V2000
    4.4203   -9.7444    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
    1.8274   -6.5480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8263   -7.3676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5343   -7.7765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2440   -7.3671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2412   -6.5444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5326   -6.1392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3674   -1.0896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3662   -1.9091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0743   -2.3181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7840   -1.9086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7811   -1.0860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0725   -0.6807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6582   -2.3171    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.0741   -3.1352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3663   -3.5437    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.7817   -3.5440    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.3661   -4.3609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6583   -4.7693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6581   -5.5865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9503   -5.9949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9501   -6.8121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2423   -7.2205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2421   -8.0377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5343   -8.4461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8266   -8.0374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1188   -8.4458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4112   -8.0370    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
    3.7034   -8.4454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4114   -7.2198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1201   -6.8134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1207   -5.9970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4125   -5.5874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7024   -6.0002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7053   -6.8153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9979   -8.0332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2906   -8.4409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2899   -9.2590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0025   -9.6676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7069   -9.2575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  2  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  8  1  0
  9 14  1  0
 10 15  1  0
 15 16  1  0
 15 17  2  0
 16 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 28 30  1  0
 28  5  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 30  1  0
 29 36  2  0
 36 37  1  0
 37 38  2  0
 38 39  1  0
 39 40  2  0
 40 29  1  0
M  CHG  2   1  -1  28   1
M  END

Associated Targets(Human)

CAL-27 (814 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HEp-2 (3859 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
SCC-15 (194 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 539.68Molecular Weight (Monoisotopic): 539.2710AlogP: 7.66#Rotatable Bonds: 15
Polar Surface Area: 46.53Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: 2HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 9.72CX Basic pKa: CX LogP: 10.02CX LogD: 10.02
Aromatic Rings: 4Heavy Atoms: 39QED Weighted: 0.10Np Likeness Score: 0.08

References

1. CatalAn, Mabel, Castro-Castillo, Vicente, Gajardo-de la Fuente, Javier, Aguilera, Jocelyn, Ferreira, Jorge, Ramires-Fernandez, Ricardo, Olmedo, Ivonne, Molina-Berrios, Alfredo, Palominos, Charlotte, Valencia, Marcelo, Dominguez, Marta, Souto, Jose A., Jara, Jose A..  (2020)  Continuous flow synthesis of lipophilic cations derived from benzoic acid as new cytotoxic chemical entities in human head and neck carcinoma cell lines,  11  (10): [PMID:33479625] [10.1039/d0md00153h]

Source