The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-((4,4-bis(3-methylthiophen-2-yl)but-3-en-1-yl)(methyl)amino)-N-(2-chlorobenzyl)-3-hydroxypropan-amide ID: ALA4796143
PubChem CID: 162674263
Max Phase: Preclinical
Molecular Formula: C25H29ClN2O2S2
Molecular Weight: 489.11
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccsc1C(=CCCN(C)C(CO)C(=O)NCc1ccccc1Cl)c1sccc1C
Standard InChI: InChI=1S/C25H29ClN2O2S2/c1-17-10-13-31-23(17)20(24-18(2)11-14-32-24)8-6-12-28(3)22(16-29)25(30)27-15-19-7-4-5-9-21(19)26/h4-5,7-11,13-14,22,29H,6,12,15-16H2,1-3H3,(H,27,30)
Standard InChI Key: PSHSIWSIFOPOKF-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 34 0 0 0 0 0 0 0 0999 V2000
3.1958 -4.5915 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
4.0207 -4.5915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2775 -3.8074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6082 -3.3207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9432 -3.8074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5048 -5.2595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3254 -5.1742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1684 -6.0129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3624 -6.1790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2752 -6.9994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0285 -7.3358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5811 -6.7234 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
5.0625 -3.5536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7514 -5.6248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8095 -5.8422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6301 -5.7570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1143 -6.4249 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.9348 -6.3397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7778 -7.1783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4189 -7.0076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2712 -5.5864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0917 -5.5011 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.7871 -4.9184 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.0825 -7.7610 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.2510 -4.6692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4274 -4.7510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7295 -5.3425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5523 -5.2610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8940 -4.5062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4066 -3.8321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5855 -3.9169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3878 -6.0933 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 1 1 0
2 6 1 0
6 7 2 0
6 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 8 1 0
3 13 1 0
9 14 1 0
7 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
17 19 1 0
18 20 1 0
18 21 1 0
21 22 1 0
21 23 2 0
20 24 1 0
22 26 1 0
25 26 1 0
25 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 25 1 0
27 32 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 489.11Molecular Weight (Monoisotopic): 488.1359AlogP: 5.51#Rotatable Bonds: 10Polar Surface Area: 52.57Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.73CX Basic pKa: 7.81CX LogP: 5.84CX LogD: 5.29Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.40Np Likeness Score: -0.89
References 1. Zaręba P,Gryzło B,Malawska K,Sałat K,Höfner GC,Nowaczyk A,Fijałkowski Ł,Rapacz A,Podkowa A,Furgała A,Żmudzki P,Wanner KT,Malawska B,Kulig K. (2020) Novel mouse GABA uptake inhibitors with enhanced inhibitory activity toward mGAT3/4 and their effect on pain threshold in mice., 188 [PMID:31901745 ] [10.1016/j.ejmech.2019.111920 ]