2-((4,4-bis(3-methylthiophen-2-yl)but-3-en-1-yl)(methyl)amino)-N-(2-chlorobenzyl)-3-hydroxypropan-amide

ID: ALA4796143

PubChem CID: 162674263

Max Phase: Preclinical

Molecular Formula: C25H29ClN2O2S2

Molecular Weight: 489.11

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ccsc1C(=CCCN(C)C(CO)C(=O)NCc1ccccc1Cl)c1sccc1C

Standard InChI:  InChI=1S/C25H29ClN2O2S2/c1-17-10-13-31-23(17)20(24-18(2)11-14-32-24)8-6-12-28(3)22(16-29)25(30)27-15-19-7-4-5-9-21(19)26/h4-5,7-11,13-14,22,29H,6,12,15-16H2,1-3H3,(H,27,30)

Standard InChI Key:  PSHSIWSIFOPOKF-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 34  0  0  0  0  0  0  0  0999 V2000
    3.1958   -4.5915    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    4.0207   -4.5915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2775   -3.8074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6082   -3.3207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9432   -3.8074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5048   -5.2595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3254   -5.1742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1684   -6.0129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3624   -6.1790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2752   -6.9994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0285   -7.3358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5811   -6.7234    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    5.0625   -3.5536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7514   -5.6248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8095   -5.8422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6301   -5.7570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1143   -6.4249    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.9348   -6.3397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7778   -7.1783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4189   -7.0076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2712   -5.5864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0917   -5.5011    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.7871   -4.9184    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.0825   -7.7610    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.2510   -4.6692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4274   -4.7510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7295   -5.3425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5523   -5.2610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8940   -4.5062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4066   -3.8321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5855   -3.9169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3878   -6.0933    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  1  1  0
  2  6  1  0
  6  7  2  0
  6  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12  8  1  0
  3 13  1  0
  9 14  1  0
  7 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 17 19  1  0
 18 20  1  0
 18 21  1  0
 21 22  1  0
 21 23  2  0
 20 24  1  0
 22 26  1  0
 25 26  1  0
 25 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 25  1  0
 27 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4796143

    ---

Associated Targets(non-human)

Slc6a11 GABA transporter 4 (930 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Slc6a1 GABA transporter 1 (1980 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Slc6a13 GABA transporter 3 (681 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 489.11Molecular Weight (Monoisotopic): 488.1359AlogP: 5.51#Rotatable Bonds: 10
Polar Surface Area: 52.57Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.73CX Basic pKa: 7.81CX LogP: 5.84CX LogD: 5.29
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.40Np Likeness Score: -0.89

References

1. Zaręba P,Gryzło B,Malawska K,Sałat K,Höfner GC,Nowaczyk A,Fijałkowski Ł,Rapacz A,Podkowa A,Furgała A,Żmudzki P,Wanner KT,Malawska B,Kulig K.  (2020)  Novel mouse GABA uptake inhibitors with enhanced inhibitory activity toward mGAT3/4 and their effect on pain threshold in mice.,  188  [PMID:31901745] [10.1016/j.ejmech.2019.111920]

Source