The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
7-[2-Deoxy-alpha-L-fucopyranosyl-(1->4)-3-amino-2,3-dideoxy-alpha-L-fucopyranoside]-doxorubicinone ID: ALA4796372
PubChem CID: 162676304
Max Phase: Preclinical
Molecular Formula: C33H39NO14
Molecular Weight: 673.67
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cccc2c1C(=O)c1c(O)c3c(c(O)c1C2=O)C[C@@](O)(C(=O)CO)C[C@@H]3O[C@H]1C[C@H](N)[C@H](O[C@H]2C[C@H](O)[C@H](O)[C@H](C)O2)[C@H](C)O1
Standard InChI: InChI=1S/C33H39NO14/c1-12-27(38)17(36)8-22(45-12)48-32-13(2)46-21(7-16(32)34)47-19-10-33(43,20(37)11-35)9-15-24(19)31(42)26-25(29(15)40)28(39)14-5-4-6-18(44-3)23(14)30(26)41/h4-6,12-13,16-17,19,21-22,27,32,35-36,38,40,42-43H,7-11,34H2,1-3H3/t12-,13-,16-,17-,19-,21-,22-,27+,32+,33-/m0/s1
Standard InChI Key: DDKNKONQTRIQSW-IEALUYQASA-N
Molfile:
RDKit 2D
50 55 0 0 0 0 0 0 0 0999 V2000
28.3376 -3.4875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3252 -4.3088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6153 -4.7174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6153 -3.0624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7573 -4.3088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7573 -3.4875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9013 -4.3088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0474 -3.0748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0351 -4.7174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9054 -3.4751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1853 -3.4875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4589 -4.7298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4631 -3.0748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1069 -5.9886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3764 -6.3559 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.1812 -4.3212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7962 -6.4220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0203 -7.6189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7549 -7.2433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3393 -7.1690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1482 -5.1673 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.6153 -2.2493 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.6153 -5.5387 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.1914 -4.7174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0474 -2.2617 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.0351 -5.5387 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.8828 -3.8961 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.4400 -7.6932 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.9749 -8.4402 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.1914 -3.0748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1914 -5.5387 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.6046 -7.5446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4856 -3.4875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4733 -4.3088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4733 -5.9391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7573 -5.1301 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
31.7632 -2.9056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5532 -3.1143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5488 -2.1170 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.1290 -2.5344 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.2457 -8.8091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5641 -8.3596 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.8373 -8.7252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7879 -9.5412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4717 -9.9904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2049 -9.6236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1549 -8.2756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0573 -9.9074 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.4238 -10.8062 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.2402 -7.9903 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 1 1 0
5 6 1 0
6 8 2 0
7 10 1 0
8 1 1 0
9 2 1 0
10 4 1 0
11 13 1 0
12 5 1 0
13 6 1 0
14 21 1 1
15 14 1 0
16 11 1 0
17 14 1 0
18 19 1 0
19 17 1 0
20 15 1 0
21 12 1 0
22 4 2 0
23 3 2 0
24 7 2 0
25 8 1 0
26 9 1 0
11 27 1 6
19 28 1 6
18 29 1 6
30 10 2 0
31 24 1 0
20 32 1 6
33 30 1 0
34 33 2 0
35 31 1 0
12 36 1 1
5 9 2 0
7 3 1 0
16 12 1 0
24 34 1 0
18 20 1 0
11 37 1 0
37 38 1 0
37 39 2 0
38 40 1 0
29 41 1 0
41 42 1 0
41 46 1 0
42 43 1 0
43 44 1 0
44 45 1 0
45 46 1 0
43 47 1 6
44 48 1 6
45 49 1 6
41 50 1 6
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 673.67Molecular Weight (Monoisotopic): 673.2371AlogP: -0.12#Rotatable Bonds: 7Polar Surface Area: 244.76Molecular Species: BASEHBA: 15HBD: 7#RO5 Violations: 3HBA (Lipinski): 15HBD (Lipinski): 8#RO5 Violations (Lipinski): 3CX Acidic pKa: 7.99CX Basic pKa: 9.01CX LogP: 0.68CX LogD: 0.31Aromatic Rings: 2Heavy Atoms: 48QED Weighted: 0.16Np Likeness Score: 1.73
References 1. Wander DPA,van der Zanden SY,van der Marel GA,Overkleeft HS,Neefjes J,Codée JDC. (2020) Doxorubicin and Aclarubicin: Shuffling Anthracycline Glycans for Improved Anticancer Agents., 63 (21): [PMID:33064004 ] [10.1021/acs.jmedchem.0c01191 ]