The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(5-((4-(1-cyclopropyl-1H-indol-3-yl)pyrimidin-2-yl)amino)-4-methoxy-2-(methyl(2-(methylthio)ethyl)amino)phenyl)acrylamide ID: ALA4796376
PubChem CID: 162676308
Max Phase: Preclinical
Molecular Formula: C29H32N6O2S
Molecular Weight: 528.68
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: C=CC(=O)Nc1cc(Nc2nccc(-c3cn(C4CC4)c4ccccc34)n2)c(OC)cc1N(C)CCSC
Standard InChI: InChI=1S/C29H32N6O2S/c1-5-28(36)31-23-16-24(27(37-3)17-26(23)34(2)14-15-38-4)33-29-30-13-12-22(32-29)21-18-35(19-10-11-19)25-9-7-6-8-20(21)25/h5-9,12-13,16-19H,1,10-11,14-15H2,2-4H3,(H,31,36)(H,30,32,33)
Standard InChI Key: OZOUACMZTRKIJD-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 42 0 0 0 0 0 0 0 0999 V2000
13.4401 -26.3205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4390 -27.1479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1537 -27.5608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8702 -27.1474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8674 -26.3169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1519 -25.9077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5814 -25.9037 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.2911 -26.3178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0031 -25.9081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5736 -25.0801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1494 -28.3876 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.4327 -28.7962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7207 -27.5580 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.0082 -27.1422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0149 -26.3169 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.3032 -25.9012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5858 -26.3103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5846 -27.1396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2968 -27.5516 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.3072 -25.0745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9771 -24.5930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7263 -23.8071 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.2147 -23.1422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6423 -24.5860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9047 -23.8047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3597 -23.1888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5523 -23.3531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2927 -24.1387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8394 -24.7512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7170 -26.3216 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
14.1547 -25.0814 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.4416 -24.6665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4444 -23.8415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7258 -25.0766 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.1603 -23.4314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9716 -22.8089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3067 -22.3205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4321 -25.9103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 1 0
7 10 1 0
8 9 1 0
3 11 1 0
11 12 1 0
2 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
20 21 2 0
21 22 1 0
22 25 1 0
24 20 1 0
16 20 1 0
22 23 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
9 30 1 0
6 31 1 0
31 32 1 0
32 33 1 0
32 34 2 0
33 35 2 0
36 23 1 0
37 36 1 0
23 37 1 0
30 38 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 528.68Molecular Weight (Monoisotopic): 528.2307AlogP: 6.11#Rotatable Bonds: 11Polar Surface Area: 84.31Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.65CX Basic pKa: 3.27CX LogP: 5.73CX LogD: 5.73Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.23Np Likeness Score: -1.07
References 1. Li J,An B,Song X,Zhang Q,Chen C,Wei S,Fan R,Li X,Zou Y. (2021) Design, synthesis and biological evaluation of novel 2,4-diaryl pyrimidine derivatives as selective EGFR inhibitors., 212 [PMID:33429247 ] [10.1016/j.ejmech.2020.113019 ]