The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5'-(tert-butyl)-6-chloro-4'-(3-chloro-2-fluorophenyl)-5-fluoro-2'-phenyl-2',4'-dihydrospiro(indoline-3,3'-pyrazol)-2-one ID: ALA4796412
PubChem CID: 162674543
Max Phase: Preclinical
Molecular Formula: C26H21Cl2F2N3O
Molecular Weight: 500.38
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)(C)C1=NN(c2ccccc2)[C@]2(C(=O)Nc3cc(Cl)c(F)cc32)[C@H]1c1cccc(Cl)c1F
Standard InChI: InChI=1S/C26H21Cl2F2N3O/c1-25(2,3)23-21(15-10-7-11-17(27)22(15)30)26(33(32-23)14-8-5-4-6-9-14)16-12-19(29)18(28)13-20(16)31-24(26)34/h4-13,21H,1-3H3,(H,31,34)/t21-,26-/m0/s1
Standard InChI Key: SMORBRYKBXHMIM-LVXARBLLSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
32.1387 -1.6715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9282 -2.4640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7197 -2.2500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0812 -4.5759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8695 -4.3613 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.9090 -3.5453 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.1450 -3.2555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6335 -3.8925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8880 -4.8371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8868 -5.6566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5949 -6.0656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5931 -4.4282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3017 -4.8335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3020 -5.6521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0806 -5.9049 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.5616 -5.2424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3788 -5.2438 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.8387 -3.6774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6300 -2.8796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8359 -2.6643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2512 -3.2454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4660 -4.0449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2596 -4.2564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6864 -4.3584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0957 -5.0667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9119 -5.0641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3186 -4.3545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9031 -3.6462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0883 -3.6523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1802 -4.4286 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
29.1788 -6.0646 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
29.6268 -1.8744 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
31.1401 -2.2587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4454 -2.8767 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 5 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 4 1 0
9 10 2 0
10 11 1 0
11 14 2 0
13 12 2 0
12 9 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 4 1 0
4 13 1 1
16 17 2 0
8 18 1 1
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
5 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
9 30 1 0
10 31 1 0
20 32 1 0
7 2 1 0
2 33 1 0
19 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 500.38Molecular Weight (Monoisotopic): 499.1030AlogP: 7.13#Rotatable Bonds: 2Polar Surface Area: 44.70Molecular Species: NEUTRALHBA: 3HBD: 1#RO5 Violations: 2HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.36CX Basic pKa: 2.76CX LogP: 8.13CX LogD: 8.13Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.41Np Likeness Score: -0.78
References 1. Raposo LR,Silva A,Silva D,Roma-Rodrigues C,Espadinha M,Baptista PV,Santos MMM,Fernandes AR. (2021) Exploiting the antiproliferative potential of spiropyrazoline oxindoles in a human ovarian cancer cell line., 30 [PMID:33348171 ] [10.1016/j.bmc.2020.115880 ]