The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-Methyl-7-(3-naphthalen-2-yl-4,5-dihydro-isoxazol-5-ylmethoxy)-chromen-2-one ID: ALA4796534
PubChem CID: 162675709
Max Phase: Preclinical
Molecular Formula: C24H19NO4
Molecular Weight: 385.42
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc(=O)oc2cc(OCC3CC(c4ccc5ccccc5c4)=NO3)ccc12
Standard InChI: InChI=1S/C24H19NO4/c1-15-10-24(26)28-23-13-19(8-9-21(15)23)27-14-20-12-22(25-29-20)18-7-6-16-4-2-3-5-17(16)11-18/h2-11,13,20H,12,14H2,1H3
Standard InChI Key: KHSRIBMQHWSOIU-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 33 0 0 0 0 0 0 0 0999 V2000
22.4218 -14.5072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4207 -15.3267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1287 -15.7357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1269 -14.0983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8355 -14.5036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8363 -15.3226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5448 -15.7297 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.2531 -15.3188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2484 -14.4967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5393 -14.0933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5349 -13.2762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9624 -15.7247 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.7126 -15.7347 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.0053 -15.3256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2972 -15.7336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5544 -15.4029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0071 -16.0098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4151 -16.7179 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.2146 -16.5485 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.1976 -15.9233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8665 -15.1750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0547 -15.0887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7197 -16.5822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9089 -16.4995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5744 -15.7516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7612 -15.6685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2817 -16.3325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6211 -17.0816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4332 -17.1610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 2 0
10 5 1 0
10 11 1 0
8 12 2 0
2 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 15 1 0
20 21 2 0
21 22 1 0
22 25 2 0
24 23 2 0
23 20 1 0
17 20 1 0
24 25 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 385.42Molecular Weight (Monoisotopic): 385.1314AlogP: 4.83#Rotatable Bonds: 4Polar Surface Area: 61.03Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 2.78CX LogP: 4.66CX LogD: 4.66Aromatic Rings: 4Heavy Atoms: 29QED Weighted: 0.47Np Likeness Score: -0.45
References 1. Lingaraju GS,Balaji KS,Jayarama S,Anil SM,Kiran KR,Sadashiva MP. (2018) Synthesis of new coumarin tethered isoxazolines as potential anticancer agents., 28 (23-24): [PMID:30396758 ] [10.1016/j.bmcl.2018.10.046 ]