4-Methyl-7-(3-naphthalen-2-yl-4,5-dihydro-isoxazol-5-ylmethoxy)-chromen-2-one

ID: ALA4796534

PubChem CID: 162675709

Max Phase: Preclinical

Molecular Formula: C24H19NO4

Molecular Weight: 385.42

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1cc(=O)oc2cc(OCC3CC(c4ccc5ccccc5c4)=NO3)ccc12

Standard InChI:  InChI=1S/C24H19NO4/c1-15-10-24(26)28-23-13-19(8-9-21(15)23)27-14-20-12-22(25-29-20)18-7-6-16-4-2-3-5-17(16)11-18/h2-11,13,20H,12,14H2,1H3

Standard InChI Key:  KHSRIBMQHWSOIU-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 29 33  0  0  0  0  0  0  0  0999 V2000
   22.4218  -14.5072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4207  -15.3267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1287  -15.7357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1269  -14.0983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8355  -14.5036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8363  -15.3226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5448  -15.7297    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.2531  -15.3188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2484  -14.4967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5393  -14.0933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5349  -13.2762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9624  -15.7247    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.7126  -15.7347    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.0053  -15.3256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2972  -15.7336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5544  -15.4029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0071  -16.0098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4151  -16.7179    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.2146  -16.5485    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.1976  -15.9233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8665  -15.1750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0547  -15.0887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7197  -16.5822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9089  -16.4995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5744  -15.7516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7612  -15.6685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2817  -16.3325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6211  -17.0816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4332  -17.1610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
 10 11  1  0
  8 12  2  0
  2 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 15  1  0
 20 21  2  0
 21 22  1  0
 22 25  2  0
 24 23  2  0
 23 20  1  0
 17 20  1  0
 24 25  1  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4796534

    ---

Associated Targets(Human)

UACC-903 (393 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 385.42Molecular Weight (Monoisotopic): 385.1314AlogP: 4.83#Rotatable Bonds: 4
Polar Surface Area: 61.03Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 2.78CX LogP: 4.66CX LogD: 4.66
Aromatic Rings: 4Heavy Atoms: 29QED Weighted: 0.47Np Likeness Score: -0.45

References

1. Lingaraju GS,Balaji KS,Jayarama S,Anil SM,Kiran KR,Sadashiva MP.  (2018)  Synthesis of new coumarin tethered isoxazolines as potential anticancer agents.,  28  (23-24): [PMID:30396758] [10.1016/j.bmcl.2018.10.046]

Source