The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(Z)-5-((5-((2-Azidoethyl)-2-oxoindolin-3-ylidene)methyl)-N-(2-(diethylamino)ethyl)-2,4-dimethyl-1H-pyrrole-3-carboxamide ID: ALA4796639
PubChem CID: 162674555
Max Phase: Preclinical
Molecular Formula: C24H31N7O2
Molecular Weight: 449.56
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCN(CC)CCNC(=O)c1c(C)[nH]c(/C=C2\C(=O)Nc3ccc(CCN=[N+]=[N-])cc32)c1C
Standard InChI: InChI=1S/C24H31N7O2/c1-5-31(6-2)12-11-26-24(33)22-15(3)21(28-16(22)4)14-19-18-13-17(9-10-27-30-25)7-8-20(18)29-23(19)32/h7-8,13-14,28H,5-6,9-12H2,1-4H3,(H,26,33)(H,29,32)/b19-14-
Standard InChI Key: CYJLLGOOGFYAKL-RGEXLXHISA-N
Molfile:
RDKit 2D
33 35 0 0 0 0 0 0 0 0999 V2000
2.8693 -18.8248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8682 -19.6521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5830 -20.0650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5813 -18.4120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2966 -18.8211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2968 -19.6522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0873 -19.9087 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.5756 -19.2363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0869 -18.5641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3416 -17.7795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4006 -19.2360 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.1491 -17.6092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7007 -18.2206 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.4527 -17.8849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3657 -17.0660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5601 -16.8957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2238 -16.1424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9783 -16.5133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7632 -16.7675 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.8059 -15.7066 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.1675 -18.2968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3756 -16.2148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1606 -16.4689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7731 -15.9163 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.5580 -16.1704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1705 -15.6178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6007 -15.1095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2132 -14.5568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1514 -18.4107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1510 -17.5857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8654 -17.1729 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.8626 -16.3465 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.8622 -15.5215 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 5 1 0
9 10 2 0
10 12 1 0
8 11 2 0
12 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 12 2 0
16 17 1 0
15 18 1 0
18 19 1 0
18 20 2 0
14 21 1 0
19 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
24 27 1 0
27 28 1 0
1 29 1 0
29 30 1 0
30 31 1 0
31 32 2 0
32 33 2 0
M CHG 2 32 1 33 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 449.56Molecular Weight (Monoisotopic): 449.2539AlogP: 4.05#Rotatable Bonds: 10Polar Surface Area: 125.99Molecular Species: BASEHBA: 4HBD: 3#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.46CX Basic pKa: 9.04CX LogP: 3.13CX LogD: 1.36Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.22Np Likeness Score: -0.64
References 1. Matheson CJ,Casalvieri KA,Backos DS,Minhajuddin M,Jordan CT,Reigan P. (2020) Substituted oxindol-3-ylidenes as AMP-activated protein kinase (AMPK) inhibitors., 197 [PMID:32334266 ] [10.1016/j.ejmech.2020.112316 ]