3,5-dichloro-N-[3-chloro-4-[(7-hydroxy-2-naphthyl)oxy]phenyl]-2-hydroxy-benzamide

ID: ALA4796688

PubChem CID: 162675359

Max Phase: Preclinical

Molecular Formula: C23H14Cl3NO4

Molecular Weight: 474.73

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(Nc1ccc(Oc2ccc3ccc(O)cc3c2)c(Cl)c1)c1cc(Cl)cc(Cl)c1O

Standard InChI:  InChI=1S/C23H14Cl3NO4/c24-14-9-18(22(29)20(26)10-14)23(30)27-15-3-6-21(19(25)11-15)31-17-5-2-12-1-4-16(28)7-13(12)8-17/h1-11,28-29H,(H,27,30)

Standard InChI Key:  RUCVOBRKSFLIFS-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
   29.2458  -28.9203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9540  -28.5053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9493  -27.6791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2402  -27.2757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6674  -28.9153    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.3777  -28.4998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0883  -28.9142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.7980  -28.4994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.7953  -27.6772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0769  -27.2716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3701  -27.6846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0887  -29.7355    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   33.5050  -27.2650    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.2190  -27.6699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.9287  -27.2576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2232  -28.4912    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.6369  -27.6647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.3461  -27.2531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.3423  -26.4309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6234  -26.0220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.9212  -26.4401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2057  -26.0338    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.6162  -25.2007    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   37.0599  -27.6583    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   28.5331  -28.5091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5357  -27.6883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8273  -27.2774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1158  -27.6862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1171  -28.5102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8261  -28.9173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4102  -28.9202    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
 25  1  1  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4 26  1  0
  2  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11  6  1  0
  7 12  1  0
  9 13  1  0
 13 14  1  0
 14 15  1  0
 14 16  2  0
 15 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 15  1  0
 21 22  1  0
 20 23  1  0
 18 24  1  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 25  2  0
 29 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4796688

    ---

Associated Targets(Human)

STK39 Tchem STE20/SPS1-related proline-alanine-rich protein kinase (342 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 474.73Molecular Weight (Monoisotopic): 472.9988AlogP: 7.26#Rotatable Bonds: 4
Polar Surface Area: 78.79Molecular Species: ACIDHBA: 4HBD: 3
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 5.95CX Basic pKa: CX LogP: 6.76CX LogD: 5.39
Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.29Np Likeness Score: -0.75

References

1. Fujii S,Kikuchi E,Watanabe Y,Suzuyama H,Ishigami-Yuasa M,Mori T,Isobe K,Uchida S,Kagechika H.  (2020)  Structural development of N-(4-phenoxyphenyl)benzamide derivatives as novel SPAK inhibitors blocking WNK kinase signaling.,  30  (17): [PMID:32738993] [10.1016/j.bmcl.2020.127408]

Source