N-[4-[(1-bromo-2-naphthyl)oxy]-3-chloro-phenyl]-3,5-dichloro-2-hydroxy-benzamide

ID: ALA4797256

Cas Number: 134897-45-3

PubChem CID: 1676700

Max Phase: Preclinical

Molecular Formula: C23H13BrCl3NO3

Molecular Weight: 537.62

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(Nc1ccc(Oc2ccc3ccccc3c2Br)c(Cl)c1)c1cc(Cl)cc(Cl)c1O

Standard InChI:  InChI=1S/C23H13BrCl3NO3/c24-21-15-4-2-1-3-12(15)5-7-20(21)31-19-8-6-14(11-17(19)26)28-23(30)16-9-13(25)10-18(27)22(16)29/h1-11,29H,(H,28,30)

Standard InChI Key:  LLAKCHSBOWDWHI-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
    2.5079   -4.6142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5068   -5.4337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2148   -5.8427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2130   -4.2053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9217   -4.6106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9224   -5.4296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6310   -5.8367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3392   -5.4259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3345   -4.6037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6254   -4.2004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6327   -6.6539    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
    6.0485   -5.8317    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.7546   -5.4204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4611   -5.8306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1667   -5.4200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1640   -4.6019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4497   -4.1962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7470   -4.6092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4615   -6.6478    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    8.8696   -4.1896    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.5794   -4.5945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2850   -4.1822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5837   -5.4117    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.9932   -4.5893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6983   -4.1777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6945   -3.3597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9797   -2.9550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2775   -3.3689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5661   -2.9668    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.9725   -2.1378    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   12.4079   -4.5830    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
  7 11  1  0
  8 12  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 13  1  0
 14 19  1  0
 16 20  1  0
 20 21  1  0
 21 22  1  0
 21 23  2  0
 22 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 22  1  0
 28 29  1  0
 27 30  1  0
 25 31  1  0
M  END

Associated Targets(Human)

STK39 Tchem STE20/SPS1-related proline-alanine-rich protein kinase (342 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 537.62Molecular Weight (Monoisotopic): 534.9144AlogP: 8.31#Rotatable Bonds: 4
Polar Surface Area: 58.56Molecular Species: ACIDHBA: 3HBD: 2
#RO5 Violations: 2HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 5.95CX Basic pKa: CX LogP: 7.83CX LogD: 6.47
Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.28Np Likeness Score: -1.04

References

1. Fujii S,Kikuchi E,Watanabe Y,Suzuyama H,Ishigami-Yuasa M,Mori T,Isobe K,Uchida S,Kagechika H.  (2020)  Structural development of N-(4-phenoxyphenyl)benzamide derivatives as novel SPAK inhibitors blocking WNK kinase signaling.,  30  (17): [PMID:32738993] [10.1016/j.bmcl.2020.127408]
2. Titko T, Perekhoda L, Drapak I, Tsapko Y..  (2020)  Modern trends in diuretics development.,  208  [PMID:33007663] [10.1016/j.ejmech.2020.112855]

Source