The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-{(1S)-1-(Cyclohexylmethyl)-2-[((1S)-3-hydroxy-2-oxo-1-{[(3S)-2-oxopyrrolidin-3-yl]methyl}propyl)amino]-2-oxoethyl}-4-methoxy-1H-indole-2-carboxamide ID: ALA4797483
PubChem CID: 90858302
Max Phase: Preclinical
Molecular Formula: C27H36N4O6
Molecular Weight: 512.61
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cccc2[nH]c(C(=O)N[C@@H](CC3CCCCC3)C(=O)N[C@@H](C[C@@H]3CCNC3=O)C(=O)CO)cc12
Standard InChI: InChI=1S/C27H36N4O6/c1-37-24-9-5-8-19-18(24)14-22(29-19)27(36)31-21(12-16-6-3-2-4-7-16)26(35)30-20(23(33)15-32)13-17-10-11-28-25(17)34/h5,8-9,14,16-17,20-21,29,32H,2-4,6-7,10-13,15H2,1H3,(H,28,34)(H,30,35)(H,31,36)/t17-,20-,21-/m0/s1
Standard InChI Key: LZRKKUAWIAVFRJ-YYWHXJBOSA-N
Molfile:
RDKit 2D
38 41 0 0 0 0 0 0 0 0999 V2000
40.3714 -8.0063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.7883 -8.7157 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.7799 -7.2921 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
41.6012 -7.2872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.0056 -6.5730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.0140 -7.9966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.8353 -7.9918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.8269 -6.5682 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
41.5928 -5.8636 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
43.2354 -5.8539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.0568 -5.8491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.4612 -5.1349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.4695 -6.5585 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
42.8186 -5.1445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.2271 -4.4303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.0408 -4.3430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.2060 -3.5385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.4917 -3.1341 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
42.8836 -3.6845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.0788 -3.5212 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
42.4031 -4.4244 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
45.2825 -5.1300 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.5501 -8.0111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.0652 -7.3523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.0730 -8.6811 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.2904 -8.4320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2896 -7.6126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.5806 -7.2053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.8719 -7.6165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.8768 -8.4391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.5863 -8.8426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.5788 -6.3881 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.8702 -5.9811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.2453 -8.7027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.0630 -8.6998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.4734 -7.9879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.0597 -7.2773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.2358 -7.2785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
1 3 1 0
3 4 1 0
4 5 1 0
4 6 1 6
6 7 1 0
5 8 1 0
5 9 2 0
8 10 1 0
10 11 1 0
11 12 1 0
11 13 2 0
10 14 1 1
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 15 1 0
19 20 2 0
15 21 1 6
12 22 1 0
1 23 1 0
23 24 2 0
24 27 1 0
26 25 1 0
25 23 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
28 32 1 0
32 33 1 0
7 34 1 0
7 38 1 0
34 35 1 0
35 36 1 0
36 37 1 0
37 38 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 512.61Molecular Weight (Monoisotopic): 512.2635AlogP: 1.82#Rotatable Bonds: 11Polar Surface Area: 149.62Molecular Species: NEUTRALHBA: 6HBD: 5#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 5#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.51CX Basic pKa: ┄CX LogP: 1.19CX LogD: 1.19Aromatic Rings: 2Heavy Atoms: 37QED Weighted: 0.31Np Likeness Score: 0.23
References 1. Hoffman RL,Kania RS,Brothers MA,Davies JF,Ferre RA,Gajiwala KS,He M,Hogan RJ,Kozminski K,Li LY,Lockner JW,Lou J,Marra MT,Mitchell LJ,Murray BW,Nieman JA,Noell S,Planken SP,Rowe T,Ryan K,Smith GJ,Solowiej JE,Steppan CM,Taggart B. (2020) Discovery of Ketone-Based Covalent Inhibitors of Coronavirus 3CL Proteases for the Potential Therapeutic Treatment of COVID-19., 63 (21): [PMID:33054210 ] [10.1021/acs.jmedchem.0c01063 ]