The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-N-((R)-1-(((S)-1-amino-3-methyl-1-oxobutan-2-yl)(methyl)amino)-3-(4-methoxyphenyl)-1-oxopropan-2-yl)-N,2-dimethyl-3-oxododecanamide ID: ALA4797535
PubChem CID: 162675957
Max Phase: Preclinical
Molecular Formula: C30H49N3O5
Molecular Weight: 531.74
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCCCCCC(=O)[C@@H](C)C(=O)N(C)[C@H](Cc1ccc(OC)cc1)C(=O)N(C)[C@H](C(N)=O)C(C)C
Standard InChI: InChI=1S/C30H49N3O5/c1-8-9-10-11-12-13-14-15-26(34)22(4)29(36)32(5)25(20-23-16-18-24(38-7)19-17-23)30(37)33(6)27(21(2)3)28(31)35/h16-19,21-22,25,27H,8-15,20H2,1-7H3,(H2,31,35)/t22-,25-,27+/m1/s1
Standard InChI Key: UCBFZXBZZPUZLC-JBBQQGGESA-N
Molfile:
RDKit 2D
38 38 0 0 0 0 0 0 0 0999 V2000
31.8814 -20.6526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8803 -21.4722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5883 -21.8811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2980 -21.4717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2952 -20.6490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5865 -20.2438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1722 -21.8802 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.4649 -21.4710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0013 -20.2378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7106 -20.6437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4167 -20.2324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7136 -21.4609 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.0075 -21.8721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4229 -21.8668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4260 -22.6840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.1290 -21.4555 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.7198 -23.0952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0106 -22.6893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.1260 -20.6383 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.4136 -19.4152 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.1198 -19.0040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7044 -19.0093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.8291 -19.4099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.5352 -18.9986 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.8321 -20.2271 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.1167 -18.1868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.8229 -17.7755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4075 -17.7809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.1352 -23.0899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7229 -23.9124 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.3044 -23.1006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5952 -22.6946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8890 -23.1059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1797 -22.7000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4736 -23.1112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7643 -22.7053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0582 -23.1166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3489 -22.7106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
2 7 1 0
7 8 1 0
5 9 1 0
10 9 1 6
10 11 1 0
10 12 1 0
12 13 1 0
12 14 1 0
14 15 1 0
14 16 2 0
15 17 1 0
17 18 1 0
11 19 2 0
11 20 1 0
20 21 1 0
20 22 1 0
21 23 1 0
23 24 1 0
23 25 2 0
21 26 1 1
26 27 1 0
26 28 1 0
15 29 1 6
17 30 2 0
18 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
35 36 1 0
36 37 1 0
37 38 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 531.74Molecular Weight (Monoisotopic): 531.3672AlogP: 4.38#Rotatable Bonds: 18Polar Surface Area: 110.01Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.79CX Basic pKa: ┄CX LogP: 5.31CX LogD: 5.31Aromatic Rings: 1Heavy Atoms: 38QED Weighted: 0.22Np Likeness Score: 0.40
References 1. Natsume N,Ozaki K,Nakajima D,Yokoshima S,Teruya T. (2020) Structure-Activity Relationship Study of Majusculamides A and B and Their Analogues on Osteogenic Activity., 83 (8.0): [PMID:32786886 ] [10.1021/acs.jnatprod.0c00441 ]