(R)-N-((R)-1-(((S)-1-amino-3-methyl-1-oxobutan-2-yl)(methyl)amino)-3-(4-methoxyphenyl)-1-oxopropan-2-yl)-N,2-dimethyl-3-oxododecanamide

ID: ALA4797535

PubChem CID: 162675957

Max Phase: Preclinical

Molecular Formula: C30H49N3O5

Molecular Weight: 531.74

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCCCCCCC(=O)[C@@H](C)C(=O)N(C)[C@H](Cc1ccc(OC)cc1)C(=O)N(C)[C@H](C(N)=O)C(C)C

Standard InChI:  InChI=1S/C30H49N3O5/c1-8-9-10-11-12-13-14-15-26(34)22(4)29(36)32(5)25(20-23-16-18-24(38-7)19-17-23)30(37)33(6)27(21(2)3)28(31)35/h16-19,21-22,25,27H,8-15,20H2,1-7H3,(H2,31,35)/t22-,25-,27+/m1/s1

Standard InChI Key:  UCBFZXBZZPUZLC-JBBQQGGESA-N

Molfile:  

 
     RDKit          2D

 38 38  0  0  0  0  0  0  0  0999 V2000
   31.8814  -20.6526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8803  -21.4722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5883  -21.8811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2980  -21.4717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2952  -20.6490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5865  -20.2438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1722  -21.8802    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.4649  -21.4710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0013  -20.2378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.7106  -20.6437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4167  -20.2324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.7136  -21.4609    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.0075  -21.8721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4229  -21.8668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4260  -22.6840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.1290  -21.4555    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.7198  -23.0952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0106  -22.6893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.1260  -20.6383    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.4136  -19.4152    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.1198  -19.0040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.7044  -19.0093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.8291  -19.4099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.5352  -18.9986    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.8321  -20.2271    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.1167  -18.1868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.8229  -17.7755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4075  -17.7809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.1352  -23.0899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.7229  -23.9124    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.3044  -23.1006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5952  -22.6946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8890  -23.1059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1797  -22.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4736  -23.1112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7643  -22.7053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0582  -23.1166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3489  -22.7106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  2  7  1  0
  7  8  1  0
  5  9  1  0
 10  9  1  6
 10 11  1  0
 10 12  1  0
 12 13  1  0
 12 14  1  0
 14 15  1  0
 14 16  2  0
 15 17  1  0
 17 18  1  0
 11 19  2  0
 11 20  1  0
 20 21  1  0
 20 22  1  0
 21 23  1  0
 23 24  1  0
 23 25  2  0
 21 26  1  1
 26 27  1  0
 26 28  1  0
 15 29  1  6
 17 30  2  0
 18 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 35 36  1  0
 36 37  1  0
 37 38  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4797535

    ---

Associated Targets(non-human)

MC3T3-E1 (421 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 531.74Molecular Weight (Monoisotopic): 531.3672AlogP: 4.38#Rotatable Bonds: 18
Polar Surface Area: 110.01Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 11.79CX Basic pKa: CX LogP: 5.31CX LogD: 5.31
Aromatic Rings: 1Heavy Atoms: 38QED Weighted: 0.22Np Likeness Score: 0.40

References

1. Natsume N,Ozaki K,Nakajima D,Yokoshima S,Teruya T.  (2020)  Structure-Activity Relationship Study of Majusculamides A and B and Their Analogues on Osteogenic Activity.,  83  (8.0): [PMID:32786886] [10.1021/acs.jnatprod.0c00441]

Source