N-((3-(3-(2-(2-(tert-butyl)-1H-imidazol-1-yl)acetyl)phenyl)-5-isobutylthiophen-2-yl)sulfonyl)acetamide

ID: ALA4797684

PubChem CID: 162675267

Max Phase: Preclinical

Molecular Formula: C25H31N3O4S2

Molecular Weight: 501.67

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(=O)NS(=O)(=O)c1sc(CC(C)C)cc1-c1cccc(C(=O)Cn2ccnc2C(C)(C)C)c1

Standard InChI:  InChI=1S/C25H31N3O4S2/c1-16(2)12-20-14-21(23(33-20)34(31,32)27-17(3)29)18-8-7-9-19(13-18)22(30)15-28-11-10-26-24(28)25(4,5)6/h7-11,13-14,16H,12,15H2,1-6H3,(H,27,29)

Standard InChI Key:  RPFFZVRMGMREEU-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 34 36  0  0  0  0  0  0  0  0999 V2000
    7.6354   -4.6927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0576   -4.1148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8461   -4.9042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6164   -6.9600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9158   -6.3006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5055   -8.8103    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.0891   -8.8940    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.2122   -5.7294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8196   -9.2605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3635   -7.7364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8351   -4.1969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0662   -4.8942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4543   -7.9944    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    8.6673   -2.7514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8800   -4.9811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6859   -7.7404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5836   -5.5564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3834   -3.5158    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.6907   -9.0872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2713   -7.9898    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.8587   -7.2846    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.0901   -9.3114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0253   -8.2186    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    8.0317   -2.2413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3506   -2.6930    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.5681   -3.4796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4336   -6.9624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5855   -7.9887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7300   -6.3912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4554   -8.7944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0528   -3.4803    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.6499   -4.1893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2500   -3.9900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8669  -10.0763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
 12 32  1  0
 10 23  1  0
 17 12  2  0
  5 29  2  0
 26  2  1  0
 30 19  1  0
 24 14  2  0
  8 29  1  0
 16 23  1  0
 32 31  2  0
 20 13  2  0
 25 24  1  0
 30 22  1  0
 27  5  1  0
 16 27  2  0
 28 30  1  0
 27  4  1  0
 13 16  1  0
 12 15  1  0
  9  7  2  0
  6 13  1  0
 26 25  2  0
 32 11  1  0
 13 21  2  0
 11 18  1  0
 14 18  1  0
 15  8  2  0
 26 18  1  0
  4 10  2  0
 10 28  1  0
  9  6  1  0
  5 17  1  0
  2 33  1  0
  9 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4797684

    ---

Associated Targets(Human)

AGTR2 Tchem Angiotensin II type 2 (AT-2) receptor (2549 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 501.67Molecular Weight (Monoisotopic): 501.1756AlogP: 4.82#Rotatable Bonds: 8
Polar Surface Area: 98.13Molecular Species: ACIDHBA: 7HBD: 1
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 5.74CX Basic pKa: 6.94CX LogP: 4.15CX LogD: 4.26
Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.45Np Likeness Score: -1.00

References

1. Wannberg J,Gising J,Lindman J,Salander J,Gutiérrez-de-Terán H,Ablahad H,Hamid S,Grönbladh A,Spizzo I,Gaspari TA,Widdop RE,Hallberg A,Backlund M,Leśniak A,Hallberg M,Larhed M.  (2021)  N-(Methyloxycarbonyl)thiophene sulfonamides as high affinity AT2 receptor ligands.,  29  [PMID:33309749] [10.1016/j.bmc.2020.115859]

Source