The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-((3-(3-(2-(2-(tert-butyl)-1H-imidazol-1-yl)acetyl)phenyl)-5-isobutylthiophen-2-yl)sulfonyl)acetamide ID: ALA4797684
PubChem CID: 162675267
Max Phase: Preclinical
Molecular Formula: C25H31N3O4S2
Molecular Weight: 501.67
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)NS(=O)(=O)c1sc(CC(C)C)cc1-c1cccc(C(=O)Cn2ccnc2C(C)(C)C)c1
Standard InChI: InChI=1S/C25H31N3O4S2/c1-16(2)12-20-14-21(23(33-20)34(31,32)27-17(3)29)18-8-7-9-19(13-18)22(30)15-28-11-10-26-24(28)25(4,5)6/h7-11,13-14,16H,12,15H2,1-6H3,(H,27,29)
Standard InChI Key: RPFFZVRMGMREEU-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 36 0 0 0 0 0 0 0 0999 V2000
7.6354 -4.6927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0576 -4.1148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8461 -4.9042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6164 -6.9600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9158 -6.3006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5055 -8.8103 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.0891 -8.8940 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.2122 -5.7294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8196 -9.2605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3635 -7.7364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8351 -4.1969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0662 -4.8942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4543 -7.9944 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
8.6673 -2.7514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8800 -4.9811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6859 -7.7404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5836 -5.5564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3834 -3.5158 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.6907 -9.0872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2713 -7.9898 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.8587 -7.2846 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.0901 -9.3114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0253 -8.2186 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
8.0317 -2.2413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3506 -2.6930 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.5681 -3.4796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4336 -6.9624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5855 -7.9887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7300 -6.3912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4554 -8.7944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0528 -3.4803 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.6499 -4.1893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2500 -3.9900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8669 -10.0763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
12 32 1 0
10 23 1 0
17 12 2 0
5 29 2 0
26 2 1 0
30 19 1 0
24 14 2 0
8 29 1 0
16 23 1 0
32 31 2 0
20 13 2 0
25 24 1 0
30 22 1 0
27 5 1 0
16 27 2 0
28 30 1 0
27 4 1 0
13 16 1 0
12 15 1 0
9 7 2 0
6 13 1 0
26 25 2 0
32 11 1 0
13 21 2 0
11 18 1 0
14 18 1 0
15 8 2 0
26 18 1 0
4 10 2 0
10 28 1 0
9 6 1 0
5 17 1 0
2 33 1 0
9 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 501.67Molecular Weight (Monoisotopic): 501.1756AlogP: 4.82#Rotatable Bonds: 8Polar Surface Area: 98.13Molecular Species: ACIDHBA: 7HBD: 1#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 5.74CX Basic pKa: 6.94CX LogP: 4.15CX LogD: 4.26Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.45Np Likeness Score: -1.00
References 1. Wannberg J,Gising J,Lindman J,Salander J,Gutiérrez-de-Terán H,Ablahad H,Hamid S,Grönbladh A,Spizzo I,Gaspari TA,Widdop RE,Hallberg A,Backlund M,Leśniak A,Hallberg M,Larhed M. (2021) N-(Methyloxycarbonyl)thiophene sulfonamides as high affinity AT2 receptor ligands., 29 [PMID:33309749 ] [10.1016/j.bmc.2020.115859 ]