N-[4-[(1-bromo-2-naphthyl)oxy]-3-chloro-phenyl]-2,3-dimethoxy-benzamide

ID: ALA4797907

PubChem CID: 162675878

Max Phase: Preclinical

Molecular Formula: C25H19BrClNO4

Molecular Weight: 512.79

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cccc(C(=O)Nc2ccc(Oc3ccc4ccccc4c3Br)c(Cl)c2)c1OC

Standard InChI:  InChI=1S/C25H19BrClNO4/c1-30-22-9-5-8-18(24(22)31-2)25(29)28-16-11-13-20(19(27)14-16)32-21-12-10-15-6-3-4-7-17(15)23(21)26/h3-14H,1-2H3,(H,28,29)

Standard InChI Key:  IFPLDPAXKJBGDP-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
    4.5649  -12.7250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2732  -12.3101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2685  -11.4838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5593  -11.0805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9866  -12.7201    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.6968  -12.3046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4075  -12.7190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1172  -12.3042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1145  -11.4820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3961  -11.0763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6893  -11.4893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4078  -13.5403    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    8.8242  -11.0697    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.5381  -11.4746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2478  -11.0623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5424  -12.2959    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.9561  -11.4694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6653  -11.0578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6615  -10.2356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9425   -9.8268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2404  -10.2448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8495  -12.3118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8549  -11.4930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1524  -11.0812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4400  -11.4837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4345  -12.3025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1415  -12.7188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5675  -13.5422    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
   10.9578  -12.2866    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.3744  -11.4640    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.2510  -12.6967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0807  -11.0529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 22  1  1  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4 23  1  0
  2  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11  6  1  0
  7 12  1  0
  9 13  1  0
 13 14  1  0
 14 15  1  0
 14 16  2  0
 15 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 15  1  0
 22 23  2  0
 22 27  1  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
  1 28  1  0
 17 29  1  0
 18 30  1  0
 29 31  1  0
 30 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4797907

    ---

Associated Targets(Human)

STK39 Tchem STE20/SPS1-related proline-alanine-rich protein kinase (342 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 512.79Molecular Weight (Monoisotopic): 511.0186AlogP: 7.32#Rotatable Bonds: 6
Polar Surface Area: 56.79Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: CX LogP: 6.61CX LogD: 6.61
Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.29Np Likeness Score: -0.99

References

1. Fujii S,Kikuchi E,Watanabe Y,Suzuyama H,Ishigami-Yuasa M,Mori T,Isobe K,Uchida S,Kagechika H.  (2020)  Structural development of N-(4-phenoxyphenyl)benzamide derivatives as novel SPAK inhibitors blocking WNK kinase signaling.,  30  (17): [PMID:32738993] [10.1016/j.bmcl.2020.127408]

Source