NA

ID: ALA4797965

PubChem CID: 139476878

Max Phase: Preclinical

Molecular Formula: C20H21F2N9O11P2

Molecular Weight: 663.38

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Nc1ncnc2c1ncn2[C@@H]1O[C@@H]2COP(=O)(O)O[C@H]3[C@@H](F)[C@H](n4cnc5c(O)ncnc54)O[C@@H]3COP(=O)(O)O[C@H]2[C@H]1F

Standard InChI:  InChI=1S/C20H21F2N9O11P2/c21-9-13-7(39-19(9)30-5-28-11-15(23)24-3-25-16(11)30)1-37-44(35,36)42-14-8(2-38-43(33,34)41-13)40-20(10(14)22)31-6-29-12-17(31)26-4-27-18(12)32/h3-10,13-14,19-20H,1-2H2,(H,33,34)(H,35,36)(H2,23,24,25)(H,26,27,32)/t7-,8-,9-,10-,13-,14-,19-,20-/m1/s1

Standard InChI Key:  SQYPPHVIIQBZKA-QPMBAPTHSA-N

Molfile:  

 
     RDKit          2D

 48 54  0  0  0  0  0  0  0  0999 V2000
    9.8145   -3.7022    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.2231   -2.4433    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.5644   -2.9254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3352   -4.3628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5180   -4.3618    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.2645   -5.1387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9250   -5.6199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5867   -5.1403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8861   -2.9254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6299   -3.6996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1718   -4.3065    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.9699   -4.1405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2233   -3.3621    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.6797   -2.7585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9240   -6.4371    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.4870   -5.3902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3160   -6.1893    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.5385   -6.4408    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
    6.3676   -7.2399    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.9319   -5.8932    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.6312   -6.8465    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
    9.6302   -7.6637    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.3394   -6.4388    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.1153   -7.0163    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.9331   -1.9816    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.9048   -7.8059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1427   -8.1010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1864   -8.9170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9761   -9.1276    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.4202   -8.4417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3890   -8.3156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9202   -7.2487    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.5520   -9.4320    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.8294  -10.5424    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.5919  -10.2485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3143   -9.9079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7586   -9.2263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3905   -8.5028    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.5782   -8.4596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1355   -9.1460    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.5061   -9.8667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0628  -10.5533    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.4564   -7.6573    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   10.3636   -5.3938    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    7.8211   -9.1459    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.6808   -4.5565    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.7179   -7.8046    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.2132   -6.0216    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  1 10  1  0
  9  2  1  0
  2  3  2  0
  3  1  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  4  1  0
  4  1  1  1
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
  7 15  1  0
  6 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 18 20  2  0
 15 21  1  0
 21 22  1  0
 21 23  2  0
 18 24  1  0
 21 32  1  0
 14 25  1  0
 26 24  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 26  1  0
 30 31  1  0
 31 32  1  0
 28 33  1  1
 33 37  1  0
 36 34  1  0
 34 35  2  0
 35 33  1  0
 36 37  2  0
 37 38  1  0
 38 39  2  0
 39 40  1  0
 40 41  2  0
 41 36  1  0
 41 42  1  0
 27 43  1  6
  8 44  1  6
 30 45  1  6
  6 46  1  6
 26 47  1  1
  7 48  1  1
M  END

Alternative Forms

  1. Parent:

    ALA4797965

    ---

Associated Targets(Human)

STING1 Tchem Stimulator of interferon genes protein (1885 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Nuclease P1 (7 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Sting1 Stimulator of interferon genes protein (255 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 663.38Molecular Weight (Monoisotopic): 663.0804AlogP: 0.44#Rotatable Bonds: 2
Polar Surface Area: 263.43Molecular Species: ACIDHBA: 18HBD: 4
#RO5 Violations: 2HBA (Lipinski): 20HBD (Lipinski): 5#RO5 Violations (Lipinski): 2
CX Acidic pKa: 1.53CX Basic pKa: 4.92CX LogP: -2.45CX LogD: -5.08
Aromatic Rings: 4Heavy Atoms: 44QED Weighted: 0.21Np Likeness Score: 0.41

References

1. Lioux T,Mauny MA,Lamoureux A,Bascoul N,Hays M,Vernejoul F,Baudru AS,Boularan C,Lopes-Vicente J,Qushair G,Tiraby G.  (2016)  Design, Synthesis, and Biological Evaluation of Novel Cyclic Adenosine-Inosine Monophosphate (cAIMP) Analogs That Activate Stimulator of Interferon Genes (STING).,  59  (22.0): [PMID:27783523] [10.1021/acs.jmedchem.6b01300]

Source