The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(3-Chloro-4,5-dimethoxyphenyl)-5,6,7,8-tetrahydropyridylthieno[2,3-d]pyrimidin-4(3H)-one trifluoroacetic acid ID: ALA4798194
PubChem CID: 162674617
Max Phase: Preclinical
Molecular Formula: C19H17ClF3N3O5S
Molecular Weight: 377.85
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(-c2nc3sc4c(c3c(=O)[nH]2)CCNC4)cc(Cl)c1OC.O=C(O)C(F)(F)F
Standard InChI: InChI=1S/C17H16ClN3O3S.C2HF3O2/c1-23-11-6-8(5-10(18)14(11)24-2)15-20-16(22)13-9-3-4-19-7-12(9)25-17(13)21-15;3-2(4,5)1(6)7/h5-6,19H,3-4,7H2,1-2H3,(H,20,21,22);(H,6,7)
Standard InChI Key: ATUNANRZHQJRNG-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 34 0 0 0 0 0 0 0 0999 V2000
28.7683 -21.1060 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
29.1813 -21.8164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5900 -21.1036 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
28.4750 -22.2295 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
29.8914 -22.2295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5997 -21.8206 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.8914 -23.0472 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.5653 -21.7208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5653 -22.5490 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.2805 -22.9608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2805 -21.3047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9959 -21.7208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0004 -22.5454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7861 -22.7987 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
21.7788 -21.4631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2597 -22.1269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0710 -22.0405 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.4077 -21.2917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9226 -20.6279 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.1050 -20.7133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2289 -21.2064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7129 -21.8745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5358 -21.7884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8755 -21.0309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3822 -20.3627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5611 -20.4520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6187 -20.0441 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.6989 -20.9434 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.1843 -21.6133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0188 -22.4559 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.6825 -23.2080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7130 -19.6082 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 2 1 0
2 5 1 0
5 6 1 0
5 7 2 0
8 9 1 0
8 11 1 0
9 10 1 0
10 13 1 0
12 11 1 0
12 13 2 0
13 14 1 0
14 16 1 0
15 12 1 0
15 16 2 0
15 20 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
18 21 1 0
20 27 2 0
24 28 1 0
28 29 1 0
23 30 1 0
30 31 1 0
25 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 377.85Molecular Weight (Monoisotopic): 377.0601AlogP: 2.97#Rotatable Bonds: 3Polar Surface Area: 76.24Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 7.83CX Basic pKa: 8.47CX LogP: 1.94CX LogD: 1.64Aromatic Rings: 3Heavy Atoms: 25QED Weighted: 0.73Np Likeness Score: -1.29
References 1. Gold M,Köhler L,Lanzloth C,Andronache I,Anant S,Dandawate P,Biersack B,Schobert R. (2020) Synthesis and bioevaluation of new vascular-targeting and anti-angiogenic thieno[2,3-d]pyrimidin-4(3H)-ones., 189 [PMID:31958738 ] [10.1016/j.ejmech.2020.112060 ]