(S)-3-(2',6'-dimethoxybiphenyl-4-yl)-2-((S)-2-ethyl-1-(phenylsulfonyl)azetidine-2-carboxamido)propanoic acid

ID: ALA4798264

PubChem CID: 162675298

Max Phase: Preclinical

Molecular Formula: C29H32N2O7S

Molecular Weight: 552.65

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC[C@@]1(C(=O)N[C@@H](Cc2ccc(-c3c(OC)cccc3OC)cc2)C(=O)O)CCN1S(=O)(=O)c1ccccc1

Standard InChI:  InChI=1S/C29H32N2O7S/c1-4-29(17-18-31(29)39(35,36)22-9-6-5-7-10-22)28(34)30-23(27(32)33)19-20-13-15-21(16-14-20)26-24(37-2)11-8-12-25(26)38-3/h5-16,23H,4,17-19H2,1-3H3,(H,30,34)(H,32,33)/t23-,29-/m0/s1

Standard InChI Key:  PRQQKDSSBGZCOL-IADCTJSHSA-N

Molfile:  

 
     RDKit          2D

 39 42  0  0  0  0  0  0  0  0999 V2000
    6.7625   -9.9332    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0499   -9.5207    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    6.0490  -10.3440    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.1152  -10.2457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1140  -11.0731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8288  -11.4859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5453  -11.0726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5424  -10.2421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8270   -9.8330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2568  -11.4832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2567  -12.3093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9711  -12.7206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6858  -12.3070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6819  -11.4777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9670  -11.0701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5426  -12.7222    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.8278  -12.3101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9635  -10.2451    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.6761   -9.8296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4006   -9.8334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4004   -9.0084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6858   -8.5961    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.1148   -8.5957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8293   -9.0081    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.1146   -7.7707    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.9715   -9.0087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2569   -8.5964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9717   -9.8337    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.0463   -7.7995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2495   -8.0132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4632   -8.8100    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.2262   -9.5254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8165   -8.8086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9923   -8.8088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5795   -9.5241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9969  -10.2407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8197  -10.2369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9782   -8.1800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9782   -7.3471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
  7 10  1  0
 11 16  1  0
 16 17  1  0
 15 18  1  0
 18 19  1  0
  4 20  1  0
 21 20  1  6
 21 22  1  0
 21 23  1  0
 23 24  1  0
 23 25  2  0
 22 26  1  0
 27 26  1  1
 26 28  2  0
 27 29  1  0
 29 30  1  0
 30 31  1  0
 31 27  1  0
 31  2  1  0
  2 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 36 37  2  0
 37 32  1  0
 27 38  1  0
 38 39  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4798264

    ---

Associated Targets(Human)

ITGB1 Tclin Integrin alpha-4/beta-1 (2269 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 552.65Molecular Weight (Monoisotopic): 552.1930AlogP: 3.73#Rotatable Bonds: 11
Polar Surface Area: 122.24Molecular Species: ACIDHBA: 6HBD: 2
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 3.23CX Basic pKa: CX LogP: 4.01CX LogD: 0.57
Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.37Np Likeness Score: -0.38

References

1. Kumari S,Carmona AV,Tiwari AK,Trippier PC.  (2020)  Amide Bond Bioisosteres: Strategies, Synthesis, and Successes.,  63  (21.0): [PMID:32686940] [10.1021/acs.jmedchem.0c00530]

Source