1-benzyl-3-(1H-indol-3-yl)-1H-pyrazolo[3,4-d]pyrimidin-4-amine

ID: ALA4798297

PubChem CID: 162675444

Max Phase: Preclinical

Molecular Formula: C20H16N6

Molecular Weight: 340.39

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Nc1ncnc2c1c(-c1c[nH]c3ccccc13)nn2Cc1ccccc1

Standard InChI:  InChI=1S/C20H16N6/c21-19-17-18(15-10-22-16-9-5-4-8-14(15)16)25-26(20(17)24-12-23-19)11-13-6-2-1-3-7-13/h1-10,12,22H,11H2,(H2,21,23,24)

Standard InChI Key:  OPPBLIFTVOVAFM-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 26 30  0  0  0  0  0  0  0  0999 V2000
   35.0732  -21.4368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.7708  -21.0075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9315  -18.5308    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.6970  -19.3202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2634  -19.9180    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.7280  -18.3397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.7454  -20.1881    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.3984  -19.6853    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.1206  -18.9087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2960  -18.9341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0666  -19.7264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.9584  -17.5515    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.4901  -18.1757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.6996  -16.8634    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.1173  -17.4451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.4275  -17.2391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.2981  -18.0475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9332  -18.5598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.6981  -18.2690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.8241  -17.4569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.1878  -16.9440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.3527  -21.0451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6571  -21.4709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6758  -22.2902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.3963  -22.6819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0981  -22.2543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  3  4  2  0
  4  5  1  0
  5 11  2  0
 10  6  2  0
  6  3  1  0
 10 11  1  0
  8  9  2  0
  7  8  1  0
  9 10  1  0
 11  7  1  0
  6 12  1  0
  7  2  1  0
  9 13  1  0
 13 17  1  0
 16 14  1  0
 14 15  1  0
 15 13  2  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
  2  1  1  0
  1 22  2  0
  1 26  1  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4798297

    ---

Associated Targets(Human)

PRKD2 Tchem Serine/threonine-protein kinase D2 (2847 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 340.39Molecular Weight (Monoisotopic): 340.1436AlogP: 3.61#Rotatable Bonds: 3
Polar Surface Area: 85.41Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 3.66CX LogP: 3.49CX LogD: 3.49
Aromatic Rings: 5Heavy Atoms: 26QED Weighted: 0.53Np Likeness Score: -0.81

References

1. Gilles P,Kashyap RS,Freitas MJ,Ceusters S,Van Asch K,Janssens A,De Jonghe S,Persoons L,Cobbaut M,Daelemans D,Van Lint J,Voet ARD,De Borggraeve WM.  (2020)  Design, synthesis and biological evaluation of pyrazolo[3,4-d]pyrimidine-based protein kinase D inhibitors.,  205  [PMID:32835918] [10.1016/j.ejmech.2020.112638]

Source