The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-[[6-chloro-8-[(1R,2R)-2-hydroxy-2-methyl-cyclopentyl]-7-oxo-pyrido[2,3-d]pyrimidin-2-yl]amino]-N-methyl-piperidine-1-sulfonamide ID: ALA4798327
PubChem CID: 134247585
Max Phase: Preclinical
Molecular Formula: C19H27ClN6O4S
Molecular Weight: 470.98
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CNS(=O)(=O)N1CCC(Nc2ncc3cc(Cl)c(=O)n([C@@H]4CCC[C@@]4(C)O)c3n2)CC1
Standard InChI: InChI=1S/C19H27ClN6O4S/c1-19(28)7-3-4-15(19)26-16-12(10-14(20)17(26)27)11-22-18(24-16)23-13-5-8-25(9-6-13)31(29,30)21-2/h10-11,13,15,21,28H,3-9H2,1-2H3,(H,22,23,24)/t15-,19-/m1/s1
Standard InChI Key: VKQLKJVYGXNJBA-DNVCBOLYSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
11.2673 -11.6842 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.6801 -12.3941 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
12.0885 -11.6817 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.2198 -12.8109 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.2187 -13.6304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9267 -14.0394 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.9249 -12.4020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6335 -12.8073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6323 -13.6325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3424 -14.0438 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.0583 -13.6345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0595 -12.8093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3448 -12.3934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7648 -14.0451 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.3435 -14.8625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6811 -15.3410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9314 -16.1189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7487 -16.1212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0033 -15.3447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5106 -14.0385 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.8032 -13.6293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8033 -12.8124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1000 -12.4034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3895 -12.8079 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.3869 -13.6261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0947 -14.0397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9741 -12.8015 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.7682 -12.4025 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
18.7811 -15.0944 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.5808 -15.9187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9740 -13.6187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 9 2 0
8 7 2 0
7 4 1 0
8 9 1 0
8 13 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 2 0
11 14 2 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 15 1 0
15 10 1 1
5 20 1 0
20 21 1 0
21 22 1 0
21 26 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
24 2 1 0
2 27 1 0
12 28 1 0
19 29 1 0
19 30 1 1
27 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 470.98Molecular Weight (Monoisotopic): 470.1503AlogP: 1.26#Rotatable Bonds: 5Polar Surface Area: 129.45Molecular Species: NEUTRALHBA: 8HBD: 3#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.57CX Basic pKa: 2.57CX LogP: 0.02CX LogD: 0.02Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.60Np Likeness Score: -0.73