2-[2-(Furanyl-2-methyl)guanidino]-5-[4-(2-aminoimidazolino)benzyl]pyridine dihydrochloride

ID: ALA4798553

PubChem CID: 162674505

Max Phase: Preclinical

Molecular Formula: C21H25Cl2N7O

Molecular Weight: 389.46

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cl.Cl.N=C(NCc1ccco1)Nc1ccc(Cc2ccc(NC3=NCCN3)cc2)cn1

Standard InChI:  InChI=1S/C21H23N7O.2ClH/c22-20(26-14-18-2-1-11-29-18)28-19-8-5-16(13-25-19)12-15-3-6-17(7-4-15)27-21-23-9-10-24-21;;/h1-8,11,13H,9-10,12,14H2,(H2,23,24,27)(H3,22,25,26,28);2*1H

Standard InChI Key:  XPVNHYUPNHWQQZ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 31 32  0  0  0  0  0  0  0  0999 V2000
   16.5295  -29.4643    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    6.4900  -26.7825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4889  -27.6098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2037  -28.0227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9201  -27.6094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9172  -26.7789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2019  -26.3697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6301  -26.3637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3461  -26.7735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3459  -27.5961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0610  -28.0059    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.7749  -27.5905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7691  -26.7613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0534  -26.3554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4914  -27.9994    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.2038  -27.5833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7741  -28.0218    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.0599  -27.6087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1996  -26.7584    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.9203  -27.9921    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.9733  -26.7904    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.1665  -26.6182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7534  -27.3324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3050  -27.9458    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.6326  -27.5760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3492  -27.9849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4418  -28.8004    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.2496  -28.9677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6585  -28.2512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1032  -27.6410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4705  -26.4000    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  2  1  0
  6  8  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
 12 15  1  0
 15 16  1  0
  3 17  1  0
 17 18  1  0
 16 19  2  0
 16 20  1  0
 18 21  2  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 18  1  0
 20 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 26  2  0
M  END

Associated Targets(Human)

ADRA2A Tclin Adrenergic receptor alpha-2 (812 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 389.46Molecular Weight (Monoisotopic): 389.1964AlogP: 2.77#Rotatable Bonds: 6
Polar Surface Area: 110.36Molecular Species: NEUTRALHBA: 6HBD: 5
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 5#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 8.01CX LogP: 2.78CX LogD: 1.83
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.33Np Likeness Score: -0.87

References

1. McMullan M,Kelly B,Mihigo HB,Keogh AP,Rodriguez F,Brocos-Mosquera I,García-Bea A,Miranda-Azpiazu P,Callado LF,Rozas I.  (2021)  Di-aryl guanidinium derivatives: Towards improved α2-Adrenergic affinity and antagonist activity.,  209  [PMID:33139112] [10.1016/j.ejmech.2020.112947]

Source