3-(1H-indol-3-yl)-1-(3-phenylprop-2-ynyl)-1H-pyrazolo[3,4-d]pyrimidin-4-amine

ID: ALA4798985

PubChem CID: 162674530

Max Phase: Preclinical

Molecular Formula: C22H16N6

Molecular Weight: 364.41

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Nc1ncnc2c1c(-c1c[nH]c3ccccc13)nn2CC#Cc1ccccc1

Standard InChI:  InChI=1S/C22H16N6/c23-21-19-20(17-13-24-18-11-5-4-10-16(17)18)27-28(22(19)26-14-25-21)12-6-9-15-7-2-1-3-8-15/h1-5,7-8,10-11,13-14,24H,12H2,(H2,23,25,26)

Standard InChI Key:  AYCGSWSLLWLWCL-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 28 32  0  0  0  0  0  0  0  0999 V2000
    8.5516  -28.0610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2493  -27.6317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4099  -25.1550    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.1754  -25.9444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7418  -26.5422    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.2064  -24.9639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2238  -26.8123    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.8768  -26.3095    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.5990  -25.5329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7744  -25.5583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5450  -26.3507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4368  -24.1757    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.9686  -24.7999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1780  -23.4876    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.5958  -24.0693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9059  -23.8633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7765  -24.6717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4116  -25.1840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1765  -24.8932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3025  -24.0811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6662  -23.5682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8540  -28.4903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1580  -28.9186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4430  -28.5274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7475  -28.9550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7700  -29.7727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4938  -30.1610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1863  -29.7312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  3  4  2  0
  4  5  1  0
  5 11  2  0
 10  6  2  0
  6  3  1  0
 10 11  1  0
  8  9  2  0
  7  8  1  0
  9 10  1  0
 11  7  1  0
  6 12  1  0
  7  2  1  0
  9 13  1  0
 13 17  1  0
 16 14  1  0
 14 15  1  0
 15 13  2  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
  2  1  1  0
  1 22  3  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4798985

    ---

Associated Targets(Human)

PRKD2 Tchem Serine/threonine-protein kinase D2 (2847 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 364.41Molecular Weight (Monoisotopic): 364.1436AlogP: 3.61#Rotatable Bonds: 2
Polar Surface Area: 85.41Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 3.96CX LogP: 3.96CX LogD: 3.96
Aromatic Rings: 5Heavy Atoms: 28QED Weighted: 0.47Np Likeness Score: -0.67

References

1. Gilles P,Kashyap RS,Freitas MJ,Ceusters S,Van Asch K,Janssens A,De Jonghe S,Persoons L,Cobbaut M,Daelemans D,Van Lint J,Voet ARD,De Borggraeve WM.  (2020)  Design, synthesis and biological evaluation of pyrazolo[3,4-d]pyrimidine-based protein kinase D inhibitors.,  205  [PMID:32835918] [10.1016/j.ejmech.2020.112638]

Source