N-((3R,4S)-4-(6-(2,6-dichloro-3,5-dimethoxyphenyl)-8-methyl-7-oxo-7,8-dihydropyrido[2,3-d]pyrimidin-2-ylamino)tetrahydrofuran-3-yl)propionamide

ID: ALA4799328

PubChem CID: 162677155

Max Phase: Preclinical

Molecular Formula: C23H25Cl2N5O5

Molecular Weight: 522.39

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCC(=O)N[C@H]1COC[C@H]1Nc1ncc2cc(-c3c(Cl)c(OC)cc(OC)c3Cl)c(=O)n(C)c2n1

Standard InChI:  InChI=1S/C23H25Cl2N5O5/c1-5-17(31)27-13-9-35-10-14(13)28-23-26-8-11-6-12(22(32)30(2)21(11)29-23)18-19(24)15(33-3)7-16(34-4)20(18)25/h6-8,13-14H,5,9-10H2,1-4H3,(H,27,31)(H,26,28,29)/t13-,14+/m0/s1

Standard InChI Key:  SQNWZTSMOSQWFC-UONOGXRCSA-N

Molfile:  

 
     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
   24.9807   -2.1007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9796   -2.9244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6917   -3.3375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4055   -2.9239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4027   -2.0971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6899   -1.6919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2709   -3.3343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5637   -2.9188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5601   -4.5605    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.2764   -4.1543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8488   -4.1492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8574   -3.3303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1531   -2.9132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4397   -3.3179    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.4350   -4.1399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1400   -4.5492    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.6875   -0.8705    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.3981   -0.4557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1180   -3.3355    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.1193   -4.1568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6915   -4.1588    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   24.2688   -1.6923    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   24.9833   -4.5642    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.5567   -5.3818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7210   -4.5447    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.0114   -4.1323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9292   -3.3135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1266   -3.1352    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.7142   -3.8448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2578   -4.4591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0827   -5.2614    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.2998   -5.5089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1247   -6.3113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3418   -6.5629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6919   -4.9582    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  2  0
  7 10  1  0
  8 12  1  0
 11  9  1  0
  9 10  1  0
  2  7  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
  6 17  1  0
 17 18  1  0
  4 19  1  0
 19 20  1  0
  3 21  1  0
  1 22  1  0
 10 23  2  0
  9 24  1  0
 15 25  1  0
 26 25  1  1
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 26  1  0
 30 31  1  1
 31 32  1  0
 32 33  1  0
 33 34  1  0
 32 35  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4799328

    ---

Associated Targets(Human)

FGFR2 Tclin Fibroblast growth factor receptor 2 (3405 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
FGFR4 Tclin Fibroblast growth factor receptor 4 (3668 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 522.39Molecular Weight (Monoisotopic): 521.1233AlogP: 3.03#Rotatable Bonds: 7
Polar Surface Area: 116.60Molecular Species: NEUTRALHBA: 9HBD: 2
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.01CX Basic pKa: 3.64CX LogP: 2.47CX LogD: 2.47
Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.49Np Likeness Score: -0.47

References

1. Liu H,Niu D,Tham Sjin RT,Dubrovskiy A,Zhu Z,McDonald JJ,Fahnoe K,Wang Z,Munson M,Scholte A,Barrague M,Fitzgerald M,Liu J,Kothe M,Sun F,Murtie J,Ge J,Rocnik J,Harvey D,Ospina B,Perron K,Zheng G,Shehu E,D'Agostino LA.  (2020)  Discovery of Selective, Covalent FGFR4 Inhibitors with Antitumor Activity in Models of Hepatocellular Carcinoma.,  11  (10): [PMID:33062171] [10.1021/acsmedchemlett.9b00601]

Source