The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-[4-[(2,4-dioxothiazolidin-5-ylidene)methyl]phenoxy]-N-(6-methyl-2-pyridyl)acetamide ID: ALA4799445
PubChem CID: 162676616
Max Phase: Preclinical
Molecular Formula: C18H15N3O4S
Molecular Weight: 369.40
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cccc(NC(=O)COc2ccc(/C=C3\SC(=O)NC3=O)cc2)n1
Standard InChI: InChI=1S/C18H15N3O4S/c1-11-3-2-4-15(19-11)20-16(22)10-25-13-7-5-12(6-8-13)9-14-17(23)21-18(24)26-14/h2-9H,10H2,1H3,(H,19,20,22)(H,21,23,24)/b14-9-
Standard InChI Key: JSVFJFLWSXEGAA-ZROIWOOFSA-N
Molfile:
RDKit 2D
26 28 0 0 0 0 0 0 0 0999 V2000
33.9492 -24.3712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9480 -25.1949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6602 -25.6080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3699 -25.1944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3670 -24.3676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6584 -23.9624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0773 -23.9564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.7907 -24.3623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.8783 -25.1782 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
37.6824 -25.3493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0925 -24.6358 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.5392 -24.0266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0217 -26.0987 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.7056 -23.2224 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.2359 -25.6071 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.5243 -25.1938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8122 -25.6060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1007 -25.1927 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.8115 -26.4273 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.3919 -25.5994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6872 -25.1881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9789 -25.5941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9764 -26.4122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6880 -26.8225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3934 -26.4141 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.6887 -27.6397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 2 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 8 1 0
10 13 2 0
12 14 2 0
2 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
17 19 2 0
18 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
24 26 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 369.40Molecular Weight (Monoisotopic): 369.0783AlogP: 2.73#Rotatable Bonds: 5Polar Surface Area: 97.39Molecular Species: ACIDHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 6.22CX Basic pKa: 4.72CX LogP: 1.90CX LogD: 0.96Aromatic Rings: 2Heavy Atoms: 26QED Weighted: 0.79Np Likeness Score: -1.94
References 1. Joshi H,Patil V,Tilekar K,Upadhyay N,Gota V,Ramaa CS. (2020) Benzylidene thiazolidinediones: Synthesis, in vitro investigations of antiproliferative mechanisms and in vivo efficacy determination in combination with Imatinib., 30 (23.0): [PMID:32961322 ] [10.1016/j.bmcl.2020.127561 ]