Isobutyl (R)-4-(6-chloro-4((5-cyclopropyl-1H-pyrazol-3-yl)amino)quinazoline-2-carbonyl)-2-methyl piperazine-1-carboxylate

ID: ALA4799469

PubChem CID: 151629820

Max Phase: Preclinical

Molecular Formula: C25H30ClN7O3

Molecular Weight: 512.01

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)COC(=O)N1CCN(C(=O)c2nc(Nc3cc(C4CC4)[nH]n3)c3cc(Cl)ccc3n2)C[C@H]1C

Standard InChI:  InChI=1S/C25H30ClN7O3/c1-14(2)13-36-25(35)33-9-8-32(12-15(33)3)24(34)23-27-19-7-6-17(26)10-18(19)22(29-23)28-21-11-20(30-31-21)16-4-5-16/h6-7,10-11,14-16H,4-5,8-9,12-13H2,1-3H3,(H2,27,28,29,30,31)/t15-/m1/s1

Standard InChI Key:  QQGUCKBXHUFCIA-OAHLLOKOSA-N

Molfile:  

 
     RDKit          2D

 36 40  0  0  0  0  0  0  0  0999 V2000
   14.5347  -12.5674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5335  -13.3869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2416  -13.7959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2398  -12.1585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9484  -12.5638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9492  -13.3828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6577  -13.7899    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.3660  -13.3790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3612  -12.5569    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.6521  -12.1535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8269  -12.1589    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   16.6478  -11.3364    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.3533  -10.9240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0988  -11.2521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6424  -10.6419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2300   -9.9363    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.4316  -10.1106    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.4523  -10.7201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1160  -11.1969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1971  -10.3838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0753  -13.7849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0784  -14.6021    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.7814  -13.3735    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.4879  -13.7832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1919  -13.3753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1930  -12.5578    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.4838  -12.1498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7736  -12.5593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8997  -13.7839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9027  -12.1463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6105  -12.5548    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.9027  -11.3291    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.3182  -12.1462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0259  -12.5547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7336  -12.1460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0260  -13.3719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
  1 11  1  0
 10 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  1  0
 17 13  2  0
 19 18  1  0
 20 19  1  0
 18 20  1  0
 15 18  1  0
  8 21  1  0
 21 22  2  0
 21 23  1  0
 23 24  1  0
 23 28  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 25 29  1  6
 30 31  1  0
 30 32  2  0
 26 30  1  0
 31 33  1  0
 33 34  1  0
 34 35  1  0
 34 36  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4799469

    ---

Associated Targets(Human)

PAK4 Tchem Serine/threonine-protein kinase PAK 4 (3212 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 512.01Molecular Weight (Monoisotopic): 511.2099AlogP: 4.57#Rotatable Bonds: 6
Polar Surface Area: 116.34Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.18CX Basic pKa: 2.97CX LogP: 4.74CX LogD: 4.74
Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.50Np Likeness Score: -1.45

References

1. Guo J,Wang T,Wu T,Zhang K,Yin W,Zhu M,Pang Y,Hao C,He Z,Cheng M,Liu Y,Zheng J,Gu J,Zhao D.  (2020)  Synthesis, bioconversion, pharmacokinetic and pharmacodynamic evaluation of N-isopropyl-oxy-carbonyloxymethyl prodrugs of CZh-226, a potent and selective PAK4 inhibitor.,  186  [PMID:31757524] [10.1016/j.ejmech.2019.111878]

Source