The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2S,3R,4R,6R)-2-(5-(benzo[b]thiophen-2-ylmethyl)-2-hydroxy-4-methoxyphenyl)-5,5-difluoro-6-(hydroxymethyl)tetrahydro-2H-pyran-3,4-diol ID: ALA4799516
PubChem CID: 146249897
Max Phase: Preclinical
Molecular Formula: C22H22F2O6S
Molecular Weight: 452.48
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(O)c([C@@H]2O[C@H](CO)C(F)(F)[C@H](O)[C@H]2O)cc1Cc1cc2ccccc2s1
Standard InChI: InChI=1S/C22H22F2O6S/c1-29-16-9-15(26)14(20-19(27)21(28)22(23,24)18(10-25)30-20)8-12(16)7-13-6-11-4-2-3-5-17(11)31-13/h2-6,8-9,18-21,25-28H,7,10H2,1H3/t18-,19+,20+,21-/m1/s1
Standard InChI Key: GOCCTPLZCAJZLV-IVAOSVALSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
2.1750 -5.0187 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.5919 -4.3088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7702 -4.3043 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.5919 -3.4875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3013 -4.7174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0107 -4.3088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0107 -3.4875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3013 -3.0748 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.7196 -3.0810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3013 -5.5387 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.8789 -3.0810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7178 -4.7226 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.8765 -2.2597 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.4228 -3.4954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1312 -3.0896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1340 -2.2715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4225 -1.8610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7170 -2.2692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8375 -3.5006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5466 -3.0944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2895 -3.4294 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
7.6323 -2.2821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4321 -2.1149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8387 -2.8253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6554 -2.8275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0665 -2.1200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6550 -1.4087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8396 -1.4100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8424 -1.8641 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.8437 -1.0469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0085 -1.8621 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 2 1 0
4 8 1 0
2 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
7 9 1 1
5 10 1 1
4 11 1 1
6 12 1 6
11 13 1 0
9 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 9 1 0
15 19 1 0
19 20 1 0
20 21 1 0
21 24 1 0
23 22 1 0
22 20 2 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
16 29 1 0
29 30 1 0
18 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 452.48Molecular Weight (Monoisotopic): 452.1105AlogP: 3.00#Rotatable Bonds: 5Polar Surface Area: 99.38Molecular Species: NEUTRALHBA: 7HBD: 4#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.15CX Basic pKa: ┄CX LogP: 3.19CX LogD: 3.18Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.48Np Likeness Score: 0.60
References 1. Xu G,Du F,Kuo GH,Xu JZ,Liang Y,Demarest K,Gaul MD. (2020) 5,5-Difluoro- and 5-Fluoro-5-methyl-hexose-based C-Glucosides as potent and orally bioavailable SGLT1 and SGLT2 dual inhibitors., 30 (17): [PMID:32738984 ] [10.1016/j.bmcl.2020.127387 ]