(2S,3R,4R,6R)-2-(5-(benzo[b]thiophen-2-ylmethyl)-2-hydroxy-4-methoxyphenyl)-5,5-difluoro-6-(hydroxymethyl)tetrahydro-2H-pyran-3,4-diol

ID: ALA4799516

PubChem CID: 146249897

Max Phase: Preclinical

Molecular Formula: C22H22F2O6S

Molecular Weight: 452.48

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc(O)c([C@@H]2O[C@H](CO)C(F)(F)[C@H](O)[C@H]2O)cc1Cc1cc2ccccc2s1

Standard InChI:  InChI=1S/C22H22F2O6S/c1-29-16-9-15(26)14(20-19(27)21(28)22(23,24)18(10-25)30-20)8-12(16)7-13-6-11-4-2-3-5-17(11)31-13/h2-6,8-9,18-21,25-28H,7,10H2,1H3/t18-,19+,20+,21-/m1/s1

Standard InChI Key:  GOCCTPLZCAJZLV-IVAOSVALSA-N

Molfile:  

 
     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
    2.1750   -5.0187    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.5919   -4.3088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7702   -4.3043    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.5919   -3.4875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3013   -4.7174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0107   -4.3088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0107   -3.4875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3013   -3.0748    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.7196   -3.0810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3013   -5.5387    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8789   -3.0810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7178   -4.7226    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8765   -2.2597    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.4228   -3.4954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1312   -3.0896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1340   -2.2715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4225   -1.8610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7170   -2.2692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8375   -3.5006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5466   -3.0944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2895   -3.4294    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    7.6323   -2.2821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4321   -2.1149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8387   -2.8253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6554   -2.8275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0665   -2.1200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6550   -1.4087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8396   -1.4100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8424   -1.8641    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.8437   -1.0469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0085   -1.8621    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  2  1  0
  4  8  1  0
  2  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  7  9  1  1
  5 10  1  1
  4 11  1  1
  6 12  1  6
 11 13  1  0
  9 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18  9  1  0
 15 19  1  0
 19 20  1  0
 20 21  1  0
 21 24  1  0
 23 22  1  0
 22 20  2  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
 16 29  1  0
 29 30  1  0
 18 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4799516

    ---

Associated Targets(Human)

SLC5A1 Tclin Sodium/glucose cotransporter 1 (1526 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
SLC5A2 Tclin Sodium/glucose cotransporter 2 (2000 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 452.48Molecular Weight (Monoisotopic): 452.1105AlogP: 3.00#Rotatable Bonds: 5
Polar Surface Area: 99.38Molecular Species: NEUTRALHBA: 7HBD: 4
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 9.15CX Basic pKa: CX LogP: 3.19CX LogD: 3.18
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.48Np Likeness Score: 0.60

References

1. Xu G,Du F,Kuo GH,Xu JZ,Liang Y,Demarest K,Gaul MD.  (2020)  5,5-Difluoro- and 5-Fluoro-5-methyl-hexose-based C-Glucosides as potent and orally bioavailable SGLT1 and SGLT2 dual inhibitors.,  30  (17): [PMID:32738984] [10.1016/j.bmcl.2020.127387]

Source