The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2R,3S,5R)-methyl 2-(((1s,4S)-4-(2,5-difluorophenyl)cyclohexyloxy)methyl)-5-methyl-3-(N-methylsulfamoylamino)pyrrolidine-1-carboxylate ID: ALA4799832
PubChem CID: 162676844
Max Phase: Preclinical
Molecular Formula: C21H31F2N3O5S
Molecular Weight: 475.56
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CNS(=O)(=O)N[C@H]1C[C@@H](C)N(C(=O)OC)[C@H]1CO[C@H]1CC[C@@H](c2cc(F)ccc2F)CC1
Standard InChI: InChI=1S/C21H31F2N3O5S/c1-13-10-19(25-32(28,29)24-2)20(26(13)21(27)30-3)12-31-16-7-4-14(5-8-16)17-11-15(22)6-9-18(17)23/h6,9,11,13-14,16,19-20,24-25H,4-5,7-8,10,12H2,1-3H3/t13-,14-,16+,19+,20+/m1/s1
Standard InChI Key: PGWXJDASJLKIBW-RXUQYVRZSA-N
Molfile:
RDKit 2D
32 34 0 0 0 0 0 0 0 0999 V2000
9.4802 -9.7361 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.9024 -10.3181 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
9.6953 -10.5275 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.7162 -12.8852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7162 -13.7024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4215 -14.1069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1268 -13.7024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1268 -12.8852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4215 -12.4725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0100 -14.1125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3015 -13.7032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5948 -14.1122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5956 -14.9302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3088 -15.3376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0126 -14.9263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8357 -12.4787 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.5422 -12.8894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2511 -12.4828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9956 -12.8144 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.5442 -12.2087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1376 -11.4998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3378 -11.6674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7317 -11.1194 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.2970 -9.7724 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.4685 -8.9734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3566 -12.2965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1643 -13.6140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5561 -14.1599 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.9411 -13.8677 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.7248 -14.9595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3011 -12.8860 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
4.3129 -16.1548 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 1 0
4 9 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
5 10 1 1
8 16 1 1
16 17 1 0
18 17 1 1
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 18 1 0
22 23 1 1
23 2 1 0
2 24 1 0
24 25 1 0
20 26 1 1
19 27 1 0
27 28 1 0
27 29 2 0
28 30 1 0
11 31 1 0
14 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 475.56Molecular Weight (Monoisotopic): 475.1952AlogP: 2.66#Rotatable Bonds: 7Polar Surface Area: 96.97Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.38CX Basic pKa: 0.35CX LogP: 2.20CX LogD: 2.20Aromatic Rings: 1Heavy Atoms: 32QED Weighted: 0.63Np Likeness Score: -0.67