3-((1H-indol-3-yl)methyl)-1-tert-butyl-1H-pyrazolo[3,4-d]pyrimidin-4-amine

ID: ALA4799852

PubChem CID: 129316173

Max Phase: Preclinical

Molecular Formula: C18H20N6

Molecular Weight: 320.40

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)(C)n1nc(Cc2c[nH]c3ccccc23)c2c(N)ncnc21

Standard InChI:  InChI=1S/C18H20N6/c1-18(2,3)24-17-15(16(19)21-10-22-17)14(23-24)8-11-9-20-13-7-5-4-6-12(11)13/h4-7,9-10,20H,8H2,1-3H3,(H2,19,21,22)

Standard InChI Key:  WCMDCDJLTSDNJF-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 24 27  0  0  0  0  0  0  0  0999 V2000
   17.1032   -5.2416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3108   -5.4562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8949   -6.0357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8413   -3.6072    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.8402   -4.4308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5523   -4.8398    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.5505   -3.1942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0500   -4.6778    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.5330   -4.0069    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.0426   -3.3414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2633   -3.6036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2679   -4.4286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5481   -2.3729    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.7636   -6.0722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2948   -2.5586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0973   -2.3842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2398   -1.7118    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.4225   -1.6311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4143   -2.5143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7103   -2.9285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7144   -3.7454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4217   -4.1492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1305   -3.7342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1229   -2.9186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  5  2  0
  5  6  1  0
  6 12  2  0
 11  7  2  0
  7  4  1  0
 11 12  1  0
  9 10  2  0
  8  9  1  0
 10 11  1  0
 12  8  1  0
  7 13  1  0
  8  2  1  0
  2 14  1  0
 10 15  1  0
 15 16  1  0
 16 20  1  0
 19 17  1  0
 17 18  1  0
 18 16  2  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4799852

    ---

Associated Targets(Human)

PRKD2 Tchem Serine/threonine-protein kinase D2 (2847 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 320.40Molecular Weight (Monoisotopic): 320.1749AlogP: 3.24#Rotatable Bonds: 2
Polar Surface Area: 85.41Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 3.56CX LogP: 2.75CX LogD: 2.75
Aromatic Rings: 4Heavy Atoms: 24QED Weighted: 0.59Np Likeness Score: -0.69

References

1. Gilles P,Kashyap RS,Freitas MJ,Ceusters S,Van Asch K,Janssens A,De Jonghe S,Persoons L,Cobbaut M,Daelemans D,Van Lint J,Voet ARD,De Borggraeve WM.  (2020)  Design, synthesis and biological evaluation of pyrazolo[3,4-d]pyrimidine-based protein kinase D inhibitors.,  205  [PMID:32835918] [10.1016/j.ejmech.2020.112638]

Source