4-(4-(2'-(tert-Butyl)-7'-oxo-6',7'-dihydro-2'H-spiro[piperidine-4,5'-pyrano[3,2-c]pyrazole]-1-carbonyl)pyridin-2-yl)benzoic Acid

ID: ALA4799861

PubChem CID: 162677033

Max Phase: Preclinical

Molecular Formula: C27H28N4O5

Molecular Weight: 488.54

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)(C)n1cc2c(n1)C(=O)CC1(CCN(C(=O)c3ccnc(-c4ccc(C(=O)O)cc4)c3)CC1)O2

Standard InChI:  InChI=1S/C27H28N4O5/c1-26(2,3)31-16-22-23(29-31)21(32)15-27(36-22)9-12-30(13-10-27)24(33)19-8-11-28-20(14-19)17-4-6-18(7-5-17)25(34)35/h4-8,11,14,16H,9-10,12-13,15H2,1-3H3,(H,34,35)

Standard InChI Key:  FIAQCQHMUMHZHV-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 36 40  0  0  0  0  0  0  0  0999 V2000
   22.2045   -4.3996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2004   -5.2168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9021   -5.6267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6125   -5.2239    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.6166   -4.4068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9104   -3.9923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5024   -4.8041    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.2077   -3.5824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5024   -3.1697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7971   -4.3996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7971   -3.5825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0200   -3.3299    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.5396   -3.9910    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.0199   -4.6520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3175   -5.6371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3123   -6.4543    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.0279   -5.2331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7290   -5.6475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7345   -4.0131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0275   -4.4188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4445   -4.4261    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.4415   -5.2398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7224   -3.9910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3138   -3.2833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3138   -4.6987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9039   -3.9869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5024   -2.3525    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.1475   -5.6501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1430   -6.4684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8484   -6.8796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5586   -6.4737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5591   -5.6523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8532   -5.2447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2653   -6.8840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2633   -7.7012    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.9740   -6.4772    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  6  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
 11  9  1  0
 10  7  1  0
  7  1  1  0
  1  8  1  0
  8  9  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  1  0
 14 10  2  0
  4 15  1  0
 15 16  2  0
 15 17  1  0
 17 18  2  0
 18 22  1  0
 21 19  1  0
 19 20  2  0
 20 17  1  0
 21 22  2  0
 13 23  1  0
 23 24  1  0
 23 25  1  0
 23 26  1  0
  9 27  2  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 28  1  0
 22 28  1  0
 31 34  1  0
 34 35  2  0
 34 36  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4799861

    ---

Associated Targets(Human)

SLCO1B3 Tchem Solute carrier organic anion transporter family member 1B3 (2517 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
SLCO1B1 Tchem Solute carrier organic anion transporter family member 1B1 (2672 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ACACB Tchem Acetyl-CoA carboxylase 2 (3474 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ACACA Tchem Acetyl-CoA carboxylase 1 (794 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 488.54Molecular Weight (Monoisotopic): 488.2060AlogP: 4.04#Rotatable Bonds: 3
Polar Surface Area: 114.62Molecular Species: ACIDHBA: 7HBD: 1
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 3.96CX Basic pKa: 2.54CX LogP: 2.51CX LogD: -0.51
Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.59Np Likeness Score: -0.94

References

1. Huard K,Smith AC,Cappon G,Dow RL,Edmonds DJ,El-Kattan A,Esler WP,Fernando DP,Griffith DA,Kalgutkar AS,Ross TT,Bagley SW,Beebe D,Bi YA,Cabral S,Crowley C,Doran SD,Dowling MS,Liras S,Mascitti V,Niosi M,Pfefferkorn JA,Polivkova J,Préville C,Price DA,Shavnya A,Shirai N,Smith AH,Southers JR,Tess DA,Thuma BA,Varma MV,Yang X.  (2020)  Optimizing the Benefit/Risk of Acetyl-CoA Carboxylase Inhibitors through Liver Targeting.,  63  (19.0): [PMID:32809824] [10.1021/acs.jmedchem.0c00640]

Source