N-(4-bromophenyl)-2-(5-nitrothiophen-2-yl)-1H-benzo[d]imidazole-5-carboxamide

ID: ALA4799962

PubChem CID: 135391703

Max Phase: Preclinical

Molecular Formula: C18H11BrN4O3S

Molecular Weight: 443.28

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(Nc1ccc(Br)cc1)c1ccc2[nH]c(-c3ccc([N+](=O)[O-])s3)nc2c1

Standard InChI:  InChI=1S/C18H11BrN4O3S/c19-11-2-4-12(5-3-11)20-18(24)10-1-6-13-14(9-10)22-17(21-13)15-7-8-16(27-15)23(25)26/h1-9H,(H,20,24)(H,21,22)

Standard InChI Key:  ZYKNCIQPCCPYFA-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 27 30  0  0  0  0  0  0  0  0999 V2000
    6.2312   -2.2831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2301   -3.1103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9448   -3.5232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9429   -1.8703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6582   -2.2794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6631   -3.1058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4505   -3.3565    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.9324   -2.6851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4427   -2.0195    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.7585   -2.6793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2473   -3.3438    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   11.0303   -3.0843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0254   -2.2593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2394   -2.0091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7037   -3.5674    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.4553   -3.2275    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.6223   -4.3882    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.5153   -3.5222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8013   -3.1092    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.5147   -4.3471    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.0865   -3.5210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3733   -3.1059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6590   -3.5171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6580   -4.3428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3770   -4.7557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0883   -4.3421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9438   -4.7557    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9  5  1  0
 10 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 10  2  0
  8 10  1  0
 15 16  2  0
 15 17  1  0
 12 15  1  0
  2 18  1  0
 18 19  1  0
 18 20  2  0
 19 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 24 27  1  0
M  CHG  2  15   1  17  -1
M  END

Alternative Forms

  1. Parent:

    ALA4799962

    ---

Associated Targets(non-human)

Hemozoin (239 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 443.28Molecular Weight (Monoisotopic): 441.9735AlogP: 5.21#Rotatable Bonds: 4
Polar Surface Area: 100.92Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 9.78CX Basic pKa: 3.29CX LogP: 5.03CX LogD: 5.03
Aromatic Rings: 4Heavy Atoms: 27QED Weighted: 0.33Np Likeness Score: -1.98

References

1. Sharma, Mousmee, Prasher, Parteek.  (2020)  An epigrammatic status of the azole-based antimalarial drugs,  11  (2): [PMID:33479627] [10.1039/c9md00479c]

Source