The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-[8-[(1R,3R)-3-hydroxycyclohexyl]-2-[(1-methylsulfonyl-4-piperidyl)amino]-7-oxo-pyrido[2,3-d]pyrimidin-6-yl]acetamide ID: ALA4800105
PubChem CID: 134253173
Max Phase: Preclinical
Molecular Formula: C21H30N6O5S
Molecular Weight: 478.58
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CS(=O)(=O)N1CCC(Nc2ncc3cc(CC(N)=O)c(=O)n([C@@H]4CCC[C@@H](O)C4)c3n2)CC1
Standard InChI: InChI=1S/C21H30N6O5S/c1-33(31,32)26-7-5-15(6-8-26)24-21-23-12-14-9-13(10-18(22)29)20(30)27(19(14)25-21)16-3-2-4-17(28)11-16/h9,12,15-17,28H,2-8,10-11H2,1H3,(H2,22,29)(H,23,24,25)/t16-,17-/m1/s1
Standard InChI Key: MMHOKKKPDYDUDS-IAGOWNOFSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
12.1217 -18.0525 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.5344 -18.7624 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
12.9428 -18.0500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.0741 -19.1792 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.0730 -19.9987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7810 -20.4077 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.7792 -18.7703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4879 -19.1756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4867 -20.0008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1968 -20.4121 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.9126 -20.0028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9138 -19.1776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1992 -18.7617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6192 -20.4134 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.3650 -20.4068 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.6576 -19.9976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6576 -19.1808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9543 -18.7717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2439 -19.1763 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.2413 -19.9944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9491 -20.4080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8285 -19.1698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6225 -18.7708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3292 -19.1811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0379 -18.7742 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.3272 -19.9983 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.1964 -21.2261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4857 -21.6315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4815 -22.4451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1862 -22.8595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8969 -22.4541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9028 -21.6344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6002 -22.8607 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 9 2 0
8 7 2 0
7 4 1 0
8 9 1 0
8 13 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 2 0
11 14 2 0
5 15 1 0
15 16 1 0
16 17 1 0
16 21 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
19 2 1 0
2 22 1 0
12 23 1 0
23 24 1 0
24 25 1 0
24 26 2 0
27 28 1 0
27 32 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
27 10 1 1
31 33 1 6
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 478.58Molecular Weight (Monoisotopic): 478.1998AlogP: 0.13#Rotatable Bonds: 6Polar Surface Area: 160.51Molecular Species: NEUTRALHBA: 9HBD: 3#RO5 Violations: ┄HBA (Lipinski): 11HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 3.66CX LogP: -1.91CX LogD: -1.91Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.53Np Likeness Score: -0.92