The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-[2-(3,4-dihydroxyphenylethyl]-2-[[2-(4-hydroxyanilino)-2-oxo-ethyl]sulfamoyl]benzamide ID: ALA4800229
PubChem CID: 146663483
Max Phase: Preclinical
Molecular Formula: C23H23N3O7S
Molecular Weight: 485.52
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(CNS(=O)(=O)c1ccccc1C(=O)NCCc1ccc(O)c(O)c1)Nc1ccc(O)cc1
Standard InChI: InChI=1S/C23H23N3O7S/c27-17-8-6-16(7-9-17)26-22(30)14-25-34(32,33)21-4-2-1-3-18(21)23(31)24-12-11-15-5-10-19(28)20(29)13-15/h1-10,13,25,27-29H,11-12,14H2,(H,24,31)(H,26,30)
Standard InChI Key: UFGZPCVLDNZWSV-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 36 0 0 0 0 0 0 0 0999 V2000
17.8367 -27.6201 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.3078 -26.9428 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.4844 -26.8725 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
15.3442 -27.2913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3430 -28.1186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0579 -28.5315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7743 -28.1182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7714 -27.2876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0561 -26.8785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0535 -26.0536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7668 -25.6389 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.3379 -25.6432 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.4812 -26.0475 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.1941 -25.6323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9101 -26.0421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9133 -26.8670 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.6231 -25.6269 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.3390 -26.0367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3375 -26.8591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0527 -27.2687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7666 -26.8535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7608 -26.0243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0451 -25.6183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4832 -27.2624 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.3355 -24.8182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6197 -24.4078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6173 -23.5828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3298 -23.1727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3277 -22.3485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6114 -21.9374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8958 -22.3564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9015 -23.1793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6079 -21.1124 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.1788 -21.9486 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3 2 2 0
1 3 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
9 10 1 0
10 11 2 0
10 12 1 0
8 3 1 0
3 13 1 0
13 14 1 0
14 15 1 0
15 16 2 0
15 17 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
21 24 1 0
12 25 1 0
25 26 1 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
30 33 1 0
31 34 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 485.52Molecular Weight (Monoisotopic): 485.1257AlogP: 1.69#Rotatable Bonds: 9Polar Surface Area: 165.06Molecular Species: NEUTRALHBA: 7HBD: 6#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 6#RO5 Violations (Lipinski): 1CX Acidic pKa: 8.90CX Basic pKa: ┄CX LogP: 1.89CX LogD: 1.88Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.20Np Likeness Score: -1.01
References 1. Bazan HA,Bhattacharjee S,Burgos C,Recio J,Abet V,Pahng AR,Jun B,Heap J,Ledet AJ,Gordon WC,Edwards S,Paul D,Alvarez-Builla J,Bazan NG. (2020) A novel pipeline of 2-(benzenesulfonamide)-N-(4-hydroxyphenyl) acetamide analgesics that lack hepatotoxicity and retain antipyresis., 202 [PMID:32629335 ] [10.1016/j.ejmech.2020.112600 ]