The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
NA ID: ALA4800299
PubChem CID: 162677256
Max Phase: Preclinical
Molecular Formula: C31H34O7
Molecular Weight: 518.61
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc2c(c(OC)c1OC)-c1c(cc3c(c1OC)CC3)[C@@H](C(=O)Oc1ccccc1)[C@@](C)(O)[C@@H](C)C2
Standard InChI: InChI=1S/C31H34O7/c1-17-14-19-16-23(34-3)28(36-5)29(37-6)24(19)25-22(15-18-12-13-21(18)27(25)35-4)26(31(17,2)33)30(32)38-20-10-8-7-9-11-20/h7-11,15-17,26,33H,12-14H2,1-6H3/t17-,26-,31-/m0/s1
Standard InChI Key: UGKBUZRULUXLLI-HLSZOEHGSA-N
Molfile:
RDKit 2D
38 42 0 0 0 0 0 0 0 0999 V2000
15.7021 -10.6168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8767 -10.6168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2894 -11.3315 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.2932 -9.2078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8779 -9.7925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2932 -11.1984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8866 -9.7935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4679 -9.2078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2507 -8.4136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4528 -8.2042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8722 -8.7950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0924 -9.5869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4705 -11.1991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8872 -10.6179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0944 -10.8328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8836 -11.6285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4718 -12.2092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2625 -11.9911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6087 -11.9611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1060 -12.6157 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.4270 -12.0691 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.7425 -12.8317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2389 -13.4849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5538 -14.2470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3729 -14.3556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8761 -13.6960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5584 -12.9366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6406 -9.4772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2337 -7.4084 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.8133 -6.8208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0731 -8.5886 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.8523 -7.7933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2670 -9.5788 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.8613 -8.8600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5092 -10.2509 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.7125 -10.4669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2944 -12.2177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8827 -12.7983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 1
3 2 1 0
8 4 1 0
4 5 1 0
5 2 1 0
2 6 1 0
6 13 1 0
14 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
6 19 1 6
19 20 2 0
19 21 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
5 28 1 6
10 29 1 0
29 30 1 0
11 31 1 0
31 32 1 0
12 33 1 0
33 34 1 0
15 35 1 0
35 36 1 0
16 37 1 0
17 38 1 0
38 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 518.61Molecular Weight (Monoisotopic): 518.2305AlogP: 5.12#Rotatable Bonds: 6Polar Surface Area: 83.45Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 5.45CX LogD: 5.45Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.36Np Likeness Score: 1.26
References 1. Nguyen T,Marusich J,Li JX,Zhang Y. (2020) Neuropeptide FF and Its Receptors: Therapeutic Applications and Ligand Development., 63 (21.0): [PMID:32673481 ] [10.1021/acs.jmedchem.0c00643 ]