The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3beta,23-O-isopropylidenyl-3beta,23-dihydroxylup-28-oic acid ID: ALA4800408
PubChem CID: 162676932
Max Phase: Preclinical
Molecular Formula: C33H52O4
Molecular Weight: 512.78
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C=C(C)[C@@H]1CC[C@]2(C(=O)O)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC[C@@H]6OC(C)(C)OC[C@@]6(C)[C@@H]5CC[C@]43C)[C@@H]12
Standard InChI: InChI=1S/C33H52O4/c1-20(2)21-11-16-33(27(34)35)18-17-31(7)22(26(21)33)9-10-24-29(5)14-13-25-30(6,19-36-28(3,4)37-25)23(29)12-15-32(24,31)8/h21-26H,1,9-19H2,2-8H3,(H,34,35)/t21-,22+,23+,24+,25-,26+,29-,30-,31+,32+,33-/m0/s1
Standard InChI Key: QSOINUFDMMDDSM-ANRHJZJOSA-N
Molfile:
RDKit 2D
42 47 0 0 0 0 0 0 0 0999 V2000
14.1358 -15.4936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5485 -14.7879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7309 -14.7833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8037 -12.3528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0938 -12.7531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6699 -12.7614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2234 -11.5315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5135 -11.1105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8037 -11.5315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3798 -12.3487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6699 -13.5827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6869 -10.3139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9209 -11.9401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5094 -12.7614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0938 -13.5745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2234 -12.3528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8343 -10.9826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0938 -11.1105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9559 -12.3487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3798 -13.9913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3715 -11.5191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5082 -10.2273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1421 -9.6990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6391 -11.5315 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.2584 -12.7614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4021 -8.9189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7995 -13.1741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9209 -12.7614 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.0896 -11.9318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6575 -11.9401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3331 -9.8641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6699 -14.3958 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
19.5094 -11.9318 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
18.8037 -10.7102 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
17.3715 -13.1700 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
15.9559 -13.9913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2584 -13.5827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5596 -13.9803 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.2498 -15.1966 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.9546 -14.7974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5485 -13.1741 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
15.9517 -13.1741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
5 4 1 0
6 10 1 0
7 16 1 0
8 9 1 0
9 4 1 0
10 5 1 0
11 20 1 0
36 11 1 0
12 8 1 0
7 13 1 1
14 4 1 0
15 5 1 0
16 14 1 0
17 7 1 0
18 9 1 0
19 6 1 0
20 15 1 0
21 18 1 0
22 12 1 0
12 23 1 6
24 13 2 0
25 19 1 0
26 23 2 0
4 27 1 6
28 13 1 0
5 29 1 1
6 30 1 1
31 23 1 0
11 32 1 6
8 33 1 6
9 34 1 1
10 35 1 6
7 8 1 0
21 10 1 0
22 17 1 0
11 6 1 0
37 25 1 0
36 37 1 0
36 40 1 0
37 38 1 0
38 2 1 0
2 39 1 0
39 40 1 0
37 41 1 6
36 42 1 1
M END Associated Targets(Human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 512.78Molecular Weight (Monoisotopic): 512.3866AlogP: 7.86#Rotatable Bonds: 2Polar Surface Area: 55.76Molecular Species: ACIDHBA: 3HBD: 1#RO5 Violations: 2HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 4.75CX Basic pKa: ┄CX LogP: 7.06CX LogD: 4.46Aromatic Rings: ┄Heavy Atoms: 37QED Weighted: 0.38Np Likeness Score: 2.83
References 1. Zhang JF,Zhong WC,Li YC,Song YQ,Xia GY,Tian GH,Ge GB,Lin S. (2020) Bioactivity-Guided Discovery of Human Carboxylesterase Inhibitors from the Roots of Paeonia lactiflora., 83 (10): [PMID:32951423 ] [10.1021/acs.jnatprod.0c00464 ]