The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2S,4S)-pentyl 1-(2-chlorobenzyl)-4-(4-methoxybenzylamino)pyrrolidine-2-carboxylate ID: ALA4800557
PubChem CID: 162676733
Max Phase: Preclinical
Molecular Formula: C25H33ClN2O3
Molecular Weight: 445.00
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCOC(=O)[C@@H]1C[C@H](NCc2ccc(OC)cc2)CN1Cc1ccccc1Cl
Standard InChI: InChI=1S/C25H33ClN2O3/c1-3-4-7-14-31-25(29)24-15-21(27-16-19-10-12-22(30-2)13-11-19)18-28(24)17-20-8-5-6-9-23(20)26/h5-6,8-13,21,24,27H,3-4,7,14-18H2,1-2H3/t21-,24-/m0/s1
Standard InChI Key: STNVYHOLXHHKAU-URXFXBBRSA-N
Molfile:
RDKit 2D
31 33 0 0 0 0 0 0 0 0999 V2000
10.3041 -11.3375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1292 -11.3375 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.3860 -10.5534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7166 -10.0667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0517 -10.5534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2669 -10.2988 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.0950 -9.4920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3103 -9.2373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1436 -8.4323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3597 -8.1776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7459 -8.7302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9212 -9.5407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7049 -9.7916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9607 -8.4766 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.7878 -7.6700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6133 -12.0055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2768 -12.7589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4552 -12.8395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1188 -13.5921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6031 -14.2610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4276 -14.1727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7603 -13.4200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1743 -10.2976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7866 -10.8505 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.3470 -9.4908 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.5717 -10.5966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1840 -11.1495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9689 -10.8956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5813 -11.4486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3662 -11.1947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5805 -13.3314 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 1 1 0
5 6 1 1
6 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
11 14 1 0
14 15 1 0
2 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
23 24 1 0
23 25 2 0
3 23 1 1
24 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
22 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 445.00Molecular Weight (Monoisotopic): 444.2180AlogP: 4.81#Rotatable Bonds: 11Polar Surface Area: 50.80Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 8.39CX LogP: 5.27CX LogD: 4.25Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.40Np Likeness Score: -1.02
References 1. Nguyen T,Marusich J,Li JX,Zhang Y. (2020) Neuropeptide FF and Its Receptors: Therapeutic Applications and Ligand Development., 63 (21.0): [PMID:32673481 ] [10.1021/acs.jmedchem.0c00643 ]