(2S,4S)-pentyl 1-(2-chlorobenzyl)-4-(4-methoxybenzylamino)pyrrolidine-2-carboxylate

ID: ALA4800557

PubChem CID: 162676733

Max Phase: Preclinical

Molecular Formula: C25H33ClN2O3

Molecular Weight: 445.00

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCCOC(=O)[C@@H]1C[C@H](NCc2ccc(OC)cc2)CN1Cc1ccccc1Cl

Standard InChI:  InChI=1S/C25H33ClN2O3/c1-3-4-7-14-31-25(29)24-15-21(27-16-19-10-12-22(30-2)13-11-19)18-28(24)17-20-8-5-6-9-23(20)26/h5-6,8-13,21,24,27H,3-4,7,14-18H2,1-2H3/t21-,24-/m0/s1

Standard InChI Key:  STNVYHOLXHHKAU-URXFXBBRSA-N

Molfile:  

 
     RDKit          2D

 31 33  0  0  0  0  0  0  0  0999 V2000
   10.3041  -11.3375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1292  -11.3375    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.3860  -10.5534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7166  -10.0667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0517  -10.5534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2669  -10.2988    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.0950   -9.4920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3103   -9.2373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1436   -8.4323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3597   -8.1776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7459   -8.7302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9212   -9.5407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7049   -9.7916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9607   -8.4766    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7878   -7.6700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6133  -12.0055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2768  -12.7589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4552  -12.8395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1188  -13.5921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6031  -14.2610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4276  -14.1727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7603  -13.4200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1743  -10.2976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7866  -10.8505    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.3470   -9.4908    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.5717  -10.5966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1840  -11.1495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9689  -10.8956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5813  -11.4486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3662  -11.1947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5805  -13.3314    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  1  1  0
  5  6  1  1
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  8  1  0
 11 14  1  0
 14 15  1  0
  2 16  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 23 24  1  0
 23 25  2  0
  3 23  1  1
 24 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 22 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4800557

    ---

Associated Targets(Human)

NPFFR1 Tchem Neuropeptide FF receptor 1 (514 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
NPFFR2 Tchem Neuropeptide FF receptor 2 (533 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 445.00Molecular Weight (Monoisotopic): 444.2180AlogP: 4.81#Rotatable Bonds: 11
Polar Surface Area: 50.80Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 8.39CX LogP: 5.27CX LogD: 4.25
Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.40Np Likeness Score: -1.02

References

1. Nguyen T,Marusich J,Li JX,Zhang Y.  (2020)  Neuropeptide FF and Its Receptors: Therapeutic Applications and Ligand Development.,  63  (21.0): [PMID:32673481] [10.1021/acs.jmedchem.0c00643]

Source