N-(3-chloro-2-fluorophenyl)-7-(pyridin-4-yl)-2,3-dihydrobenzo[f][1,4]oxazepine-4(5H)-carboxamide

ID: ALA4800653

PubChem CID: 162677474

Max Phase: Preclinical

Molecular Formula: C21H17ClFN3O2

Molecular Weight: 397.84

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(Nc1cccc(Cl)c1F)N1CCOc2ccc(-c3ccncc3)cc2C1

Standard InChI:  InChI=1S/C21H17ClFN3O2/c22-17-2-1-3-18(20(17)23)25-21(27)26-10-11-28-19-5-4-15(12-16(19)13-26)14-6-8-24-9-7-14/h1-9,12H,10-11,13H2,(H,25,27)

Standard InChI Key:  LTYFJRNHLBKAMG-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 28 31  0  0  0  0  0  0  0  0999 V2000
   14.1220  -29.4230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1208  -30.2425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8289  -30.6515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8271  -29.0141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4147  -30.6508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7070  -30.2400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9995  -30.6473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9984  -31.4654    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.7107  -31.8744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4154  -31.4647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5405  -30.2396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5357  -29.4194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1767  -28.8984    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.1905  -30.7493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9811  -29.0711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9935  -30.5580    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.3425  -29.8104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5098  -31.1914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2194  -31.9553    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.3165  -31.0610    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.8329  -31.6944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5397  -32.4568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0553  -33.0899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8630  -32.9597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1524  -32.1910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6350  -31.5612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9586  -32.0577    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   19.9222  -30.7962    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3 11  2  0
 12  4  2  0
  4  1  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
  2  5  1  0
 11 12  1  0
 12 13  1  0
 11 14  1  0
 13 15  1  0
 14 16  1  0
 15 17  1  0
 16 17  1  0
 16 18  1  0
 18 19  2  0
 18 20  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 25 27  1  0
 26 28  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4800653

    ---

Associated Targets(Human)

GPR142 Tchem Probable G-protein coupled receptor 142 (378 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Gpr142 Probable G-protein coupled receptor 142 (77 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 397.84Molecular Weight (Monoisotopic): 397.0993AlogP: 4.97#Rotatable Bonds: 2
Polar Surface Area: 54.46Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 11.28CX Basic pKa: 5.16CX LogP: 3.90CX LogD: 3.89
Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.66Np Likeness Score: -1.93

References

1. Wilson JE,Kurukulasuriya R,Sinz C,Lombardo M,Bender K,Parker D,Sherer EC,Costa M,Dingley K,Li X,Mitelman S,Tong S,Bugianesi R,Ehrhardt A,Priest B,Ratliff K,Ujjainwalla F,Nargund R,Hagmann WK,Edmondson S.  (2016)  Discovery and development of benzo-[1,2,4]-triazolo-[1,4]-oxazepine GPR142 agonists for the treatment of diabetes.,  26  (12.0): [PMID:27240550] [10.1016/j.bmcl.2016.04.018]

Source