The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
NA ID: ALA4802119
PubChem CID: 162677497
Max Phase: Preclinical
Molecular Formula: C33H43NO4
Molecular Weight: 517.71
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C=C[C@@]1(C)C=C(C)[C@@H]2[C@@H]3[C@H](Oc4ccc(cc4)C[C@]4(OC)C[C@H](C(=O)N4)C(=O)[C@H]31)[C@@H]1[C@@H](C)C[C@@H](C)C[C@]12C
Standard InChI: InChI=1S/C33H43NO4/c1-8-31(5)15-20(4)25-24-27(31)28(35)23-17-33(37-7,34-30(23)36)16-21-9-11-22(12-10-21)38-29(24)26-19(3)13-18(2)14-32(25,26)6/h8-12,15,18-19,23-27,29H,1,13-14,16-17H2,2-7H3,(H,34,36)/t18-,19+,23+,24+,25-,26+,27+,29+,31+,32+,33+/m1/s1
Standard InChI Key: LCKLFHNMJWXRII-BCGLTIKRSA-N
Molfile:
RDKit 2D
44 49 0 0 0 0 0 0 0 0999 V2000
44.8593 -7.5175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.6709 -7.6870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.2708 -7.0822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.9385 -6.3284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.1362 -6.1506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.5560 -6.7267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.4696 -4.3007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
47.2994 -4.2377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
47.6188 -5.0064 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
47.0087 -5.5895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.3128 -5.1168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.3060 -4.6213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.5040 -5.4222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.2966 -5.6511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.9005 -4.0494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.6931 -4.2783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.8912 -5.0791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.7274 -5.2152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.4035 -3.8339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.0455 -4.3842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.3086 -2.6850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.5368 -2.9928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.9485 -3.1995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.8262 -4.0332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.6939 -3.9763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.9142 -1.7710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.3438 -2.4754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.5134 -4.3924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.4947 -6.4520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.1778 -3.5491 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
42.5789 -3.4612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.6452 -4.9507 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
42.8923 -2.4778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.7697 -3.1207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.3707 -4.6530 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
45.9539 -3.3486 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
42.0986 -4.8502 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
43.9713 -6.0699 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
46.8929 -6.4558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
47.7310 -3.5346 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
47.7440 -5.9634 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
48.4356 -5.5136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.6012 -3.4863 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
44.5516 -5.2513 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 1 0
8 9 1 0
10 9 1 0
10 11 1 0
7 11 1 0
12 13 1 0
12 15 1 0
14 13 1 0
14 17 1 0
16 15 1 0
16 17 1 0
17 18 1 0
18 20 1 0
19 16 1 0
19 20 1 0
19 22 1 0
20 24 1 0
23 21 1 0
21 22 2 0
23 24 1 0
23 27 1 6
24 25 1 0
7 25 1 0
26 27 2 0
12 28 1 1
14 29 1 1
19 30 1 1
16 31 1 6
20 32 1 6
22 33 1 0
23 34 1 0
24 35 1 1
25 36 2 0
17 37 1 1
18 38 1 0
38 6 1 0
3 39 1 0
8 40 2 0
10 39 1 0
10 41 1 1
41 42 1 0
7 43 1 6
18 44 1 1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 517.71Molecular Weight (Monoisotopic): 517.3192AlogP: 5.74#Rotatable Bonds: 2Polar Surface Area: 64.63Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 10.80CX Basic pKa: ┄CX LogP: 5.83CX LogD: 5.83Aromatic Rings: 1Heavy Atoms: 38QED Weighted: 0.40Np Likeness Score: 2.04
References 1. Ge H,Shi M,Ma M,Lian XY,Zhang Z. (2021) Evaluation of the antiproliferative activity of 106 marine microbial metabolites against human lung cancer cells and potential antiproliferative mechanism of purpuride G., 39 [PMID:33691166 ] [10.1016/j.bmcl.2021.127915 ]