butyl 5-isobutyl-3-(4-(thiazol-2-ylcarbamoyl)phenyl)thiophen-2-ylsulfonylcarbamate

ID: ALA480341

PubChem CID: 44567782

Max Phase: Preclinical

Molecular Formula: C23H27N3O5S3

Molecular Weight: 521.69

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCOC(=O)NS(=O)(=O)c1sc(CC(C)C)cc1-c1ccc(C(=O)Nc2nccs2)cc1

Standard InChI:  InChI=1S/C23H27N3O5S3/c1-4-5-11-31-23(28)26-34(29,30)21-19(14-18(33-21)13-15(2)3)16-6-8-17(9-7-16)20(27)25-22-24-10-12-32-22/h6-10,12,14-15H,4-5,11,13H2,1-3H3,(H,26,28)(H,24,25,27)

Standard InChI Key:  FZUTXAXDNREPQS-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 34 36  0  0  0  0  0  0  0  0999 V2000
    0.7734   -2.7214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0565   -3.1236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0494   -3.9478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7611   -4.3670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4813   -3.9559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4848   -3.1330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7603   -5.1936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0897   -5.6740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3393   -6.4603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1643   -6.4659    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    1.4244   -5.6830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2108   -5.4334    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    2.9920   -5.1747    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.4652   -6.2181    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.9582   -4.6480    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6082   -5.7234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4425   -6.5312    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.3928   -5.4641    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.0595   -7.0789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8937   -7.8870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5107   -8.4347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3450   -9.2429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1502   -7.1244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1803   -7.8804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3092   -8.5445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0001   -7.9722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7771   -1.8949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4943   -1.4871    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0654   -1.4776    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4998   -0.6621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1671   -0.1845    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.9174    0.6018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0923    0.6072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8323   -0.1757    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
  4  7  1  0
 11 12  1  0
 12 13  1  0
 12 14  2  0
 12 15  2  0
 13 16  1  0
 16 17  1  0
 16 18  2  0
 17 19  1  0
  1  2  2  0
 19 20  1  0
 20 21  1  0
  2  3  1  0
 21 22  1  0
  9 23  1  0
  3  4  2  0
 23 24  1  0
 24 25  1  0
  4  5  1  0
 24 26  1  0
  5  6  2  0
  6  1  1  0
 27 28  1  0
 27 29  2  0
  1 27  1  0
  7  8  1  0
 28 30  1  0
 30 31  2  0
  8  9  2  0
  9 10  1  0
 10 11  1  0
 11  7  2  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 30  1  0
M  END

Associated Targets(non-human)

Agtr1 Type-1A angiotensin II receptor (520 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
AGTR1 Type-1 angiotensin II receptor (25 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 521.69Molecular Weight (Monoisotopic): 521.1113AlogP: 5.54#Rotatable Bonds: 10
Polar Surface Area: 114.46Molecular Species: ACIDHBA: 8HBD: 2
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 4.61CX Basic pKa: CX LogP: 6.36CX LogD: 5.42
Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.34Np Likeness Score: -1.12

References

1. Wallinder C, Botros M, Rosenström U, Guimond MO, Beaudry H, Nyberg F, Gallo-Payet N, Hallberg A, Alterman M..  (2008)  Selective angiotensin II AT2 receptor agonists: Benzamide structure-activity relationships.,  16  (14): [PMID:18599297] [10.1016/j.bmc.2008.05.066]

Source