butyl 3-(4-(dimethylcarbamoyl)phenyl)-5-isobutylthiophen-2-ylsulfonylcarbamate

ID: ALA481088

PubChem CID: 44567744

Max Phase: Preclinical

Molecular Formula: C22H30N2O5S2

Molecular Weight: 466.63

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCOC(=O)NS(=O)(=O)c1sc(CC(C)C)cc1-c1ccc(C(=O)N(C)C)cc1

Standard InChI:  InChI=1S/C22H30N2O5S2/c1-6-7-12-29-22(26)23-31(27,28)21-19(14-18(30-21)13-15(2)3)16-8-10-17(11-9-16)20(25)24(4)5/h8-11,14-15H,6-7,12-13H2,1-5H3,(H,23,26)

Standard InChI Key:  RRXKWVYSGQFGND-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 31 32  0  0  0  0  0  0  0  0999 V2000
    2.0943   -1.1381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3774   -1.5403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3703   -2.3645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0820   -2.7837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8022   -2.3726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8057   -1.5497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0812   -3.6103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4106   -4.0907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6602   -4.8770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4852   -4.8826    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    2.7453   -4.0997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5317   -3.8501    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    4.3129   -3.5914    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.7861   -4.6348    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.2791   -3.0647    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.9291   -4.1401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7634   -4.9479    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7137   -3.8808    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.3804   -5.4956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2146   -6.3037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8316   -6.8514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6659   -7.6596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1707   -5.5411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5012   -6.2971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0117   -6.9612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3210   -6.3889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0980   -0.3115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8151    0.0962    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.3862    0.1057    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5269   -0.3210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8206    0.9212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  9 10  1  0
 10 11  1  0
 11  7  2  0
  4  7  1  0
 11 12  1  0
 12 13  1  0
 12 14  2  0
 12 15  2  0
 13 16  1  0
 16 17  1  0
 16 18  2  0
 17 19  1  0
  1  2  2  0
 19 20  1  0
 20 21  1  0
  2  3  1  0
 21 22  1  0
  9 23  1  0
  3  4  2  0
 23 24  1  0
 24 25  1  0
  4  5  1  0
 24 26  1  0
  5  6  2  0
  6  1  1  0
 27 28  1  0
 27 29  2  0
  1 27  1  0
  7  8  1  0
 28 30  1  0
  8  9  2  0
 28 31  1  0
M  END

Associated Targets(non-human)

Agtr1 Type-1A angiotensin II receptor (520 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
AGTR1 Type-1 angiotensin II receptor (25 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 466.63Molecular Weight (Monoisotopic): 466.1596AlogP: 4.53#Rotatable Bonds: 9
Polar Surface Area: 92.78Molecular Species: ACIDHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 4.61CX Basic pKa: CX LogP: 5.22CX LogD: 4.29
Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.55Np Likeness Score: -0.79

References

1. Wallinder C, Botros M, Rosenström U, Guimond MO, Beaudry H, Nyberg F, Gallo-Payet N, Hallberg A, Alterman M..  (2008)  Selective angiotensin II AT2 receptor agonists: Benzamide structure-activity relationships.,  16  (14): [PMID:18599297] [10.1016/j.bmc.2008.05.066]

Source