butyl 5-isobutyl-3-(4-(morpholine-4-carbonyl)phenyl)thiophen-2-ylsulfonylcarbamate

ID: ALA481106

PubChem CID: 44567818

Max Phase: Preclinical

Molecular Formula: C24H32N2O6S2

Molecular Weight: 508.66

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCOC(=O)NS(=O)(=O)c1sc(CC(C)C)cc1-c1ccc(C(=O)N2CCOCC2)cc1

Standard InChI:  InChI=1S/C24H32N2O6S2/c1-4-5-12-32-24(28)25-34(29,30)23-21(16-20(33-23)15-17(2)3)18-6-8-19(9-7-18)22(27)26-10-13-31-14-11-26/h6-9,16-17H,4-5,10-15H2,1-3H3,(H,25,28)

Standard InChI Key:  CJPBBWUYRIIFRL-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 34 36  0  0  0  0  0  0  0  0999 V2000
    0.5526   -0.7548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1643   -1.1570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1714   -1.9812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5403   -2.4004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2605   -1.9893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2640   -1.1664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5395   -3.2270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1311   -3.7074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1185   -4.4937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9435   -4.4993    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    1.2036   -3.7164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9900   -3.4668    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    2.7712   -3.2081    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.2444   -4.2515    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7374   -2.6814    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.3874   -3.7568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2217   -4.5646    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.1720   -3.4975    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8387   -5.1123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6729   -5.9204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2899   -6.4681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1242   -7.2763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3710   -5.1578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0405   -5.9138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5300   -6.5779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7793   -6.0056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5563    0.0718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2735    0.4796    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1554    0.4890    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.9839    0.0574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6990    0.4617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7087    1.2870    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.9971    1.7064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2759    1.3005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  4  7  1  0
 11 12  1  0
 12 13  1  0
 12 14  2  0
 12 15  2  0
 13 16  1  0
 16 17  1  0
 16 18  2  0
 17 19  1  0
  1  2  2  0
 19 20  1  0
 20 21  1  0
  2  3  1  0
 21 22  1  0
  9 23  1  0
  3  4  2  0
 23 24  1  0
 24 25  1  0
  4  5  1  0
 24 26  1  0
  5  6  2  0
  6  1  1  0
 27 28  1  0
 27 29  2  0
  1 27  1  0
 28 30  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  1  0
 11  7  2  0
 28 34  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
M  END

Associated Targets(non-human)

Agtr1 Type-1A angiotensin II receptor (520 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
AGTR1 Type-1 angiotensin II receptor (25 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 508.66Molecular Weight (Monoisotopic): 508.1702AlogP: 4.30#Rotatable Bonds: 9
Polar Surface Area: 102.01Molecular Species: ACIDHBA: 7HBD: 1
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 4.61CX Basic pKa: CX LogP: 5.01CX LogD: 4.07
Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.51Np Likeness Score: -0.94

References

1. Wallinder C, Botros M, Rosenström U, Guimond MO, Beaudry H, Nyberg F, Gallo-Payet N, Hallberg A, Alterman M..  (2008)  Selective angiotensin II AT2 receptor agonists: Benzamide structure-activity relationships.,  16  (14): [PMID:18599297] [10.1016/j.bmc.2008.05.066]

Source