The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
butyl 5-isobutyl-3-(4-(morpholine-4-carbonyl)phenyl)thiophen-2-ylsulfonylcarbamate ID: ALA481106
PubChem CID: 44567818
Max Phase: Preclinical
Molecular Formula: C24H32N2O6S2
Molecular Weight: 508.66
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCOC(=O)NS(=O)(=O)c1sc(CC(C)C)cc1-c1ccc(C(=O)N2CCOCC2)cc1
Standard InChI: InChI=1S/C24H32N2O6S2/c1-4-5-12-32-24(28)25-34(29,30)23-21(16-20(33-23)15-17(2)3)18-6-8-19(9-7-18)22(27)26-10-13-31-14-11-26/h6-9,16-17H,4-5,10-15H2,1-3H3,(H,25,28)
Standard InChI Key: CJPBBWUYRIIFRL-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 36 0 0 0 0 0 0 0 0999 V2000
0.5526 -0.7548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1643 -1.1570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1714 -1.9812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5403 -2.4004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2605 -1.9893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2640 -1.1664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5395 -3.2270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1311 -3.7074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1185 -4.4937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9435 -4.4993 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1.2036 -3.7164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9900 -3.4668 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2.7712 -3.2081 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.2444 -4.2515 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.7374 -2.6814 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.3874 -3.7568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2217 -4.5646 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.1720 -3.4975 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8387 -5.1123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6729 -5.9204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2899 -6.4681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1242 -7.2763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3710 -5.1578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0405 -5.9138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5300 -6.5779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7793 -6.0056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5563 0.0718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2735 0.4796 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.1554 0.4890 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.9839 0.0574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6990 0.4617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7087 1.2870 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.9971 1.7064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2759 1.3005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4 7 1 0
11 12 1 0
12 13 1 0
12 14 2 0
12 15 2 0
13 16 1 0
16 17 1 0
16 18 2 0
17 19 1 0
1 2 2 0
19 20 1 0
20 21 1 0
2 3 1 0
21 22 1 0
9 23 1 0
3 4 2 0
23 24 1 0
24 25 1 0
4 5 1 0
24 26 1 0
5 6 2 0
6 1 1 0
27 28 1 0
27 29 2 0
1 27 1 0
28 30 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 1 0
11 7 2 0
28 34 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 508.66Molecular Weight (Monoisotopic): 508.1702AlogP: 4.30#Rotatable Bonds: 9Polar Surface Area: 102.01Molecular Species: ACIDHBA: 7HBD: 1#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 4.61CX Basic pKa: ┄CX LogP: 5.01CX LogD: 4.07Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.51Np Likeness Score: -0.94
References 1. Wallinder C, Botros M, Rosenström U, Guimond MO, Beaudry H, Nyberg F, Gallo-Payet N, Hallberg A, Alterman M.. (2008) Selective angiotensin II AT2 receptor agonists: Benzamide structure-activity relationships., 16 (14): [PMID:18599297 ] [10.1016/j.bmc.2008.05.066 ]