Biphenyl-4-carboxylic acid methyl-[(3-nitro-4-piperidin-1-yl-phenylcarbamoyl)-methyl]-amide

ID: ALA481480

PubChem CID: 44567922

Max Phase: Preclinical

Molecular Formula: C27H28N4O4

Molecular Weight: 472.55

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CN(CC(=O)Nc1ccc(N2CCCCC2)c([N+](=O)[O-])c1)C(=O)c1ccc(-c2ccccc2)cc1

Standard InChI:  InChI=1S/C27H28N4O4/c1-29(27(33)22-12-10-21(11-13-22)20-8-4-2-5-9-20)19-26(32)28-23-14-15-24(25(18-23)31(34)35)30-16-6-3-7-17-30/h2,4-5,8-15,18H,3,6-7,16-17,19H2,1H3,(H,28,32)

Standard InChI Key:  XQUKOEMEWVXVDO-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
   -2.6135   -6.6375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6135   -7.4629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9004   -7.8695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1874   -7.4629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1874   -6.6375    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9004   -6.2184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4707   -6.2247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2402   -6.6454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9522   -6.2333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9551   -5.4069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2399   -4.9943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4733   -5.4046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1910   -4.9952    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9056   -5.4074    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1926   -4.1697    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.6712   -4.9974    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.3861   -5.4092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1022   -4.9997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3848   -6.2347    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8171   -5.4115    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.5331   -5.0019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8157   -6.2370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2480   -5.4138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5345   -4.1764    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.2436   -6.2402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9535   -6.6562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6706   -6.2424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6693   -5.4127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9547   -5.0046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3827   -6.6540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3812   -7.4807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0957   -7.8914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8123   -7.4809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8099   -6.6511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0948   -6.2399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 16 17  1  0
  1  6  1  0
 17 18  1  0
  8  9  1  0
 17 19  2  0
  2  3  1  0
 18 20  1  0
  9 10  2  0
 20 21  1  0
  3  4  1  0
 20 22  1  0
 10 11  1  0
 21 23  1  0
  4  5  1  0
 21 24  2  0
 11 12  2  0
 23 25  2  0
 12  7  1  0
 25 26  1  0
  5  6  1  0
 26 27  2  0
 27 28  1  0
  5  7  1  0
 28 29  2  0
 29 23  1  0
 13 14  2  0
 13 15  1  0
 30 31  2  0
 12 13  1  0
 31 32  1  0
  1  2  1  0
 32 33  2  0
 10 16  1  0
 33 34  1  0
  7  8  2  0
 34 35  2  0
 35 30  1  0
 27 30  1  0
M  CHG  2  13   1  15  -1
M  END

Associated Targets(Human)

BCL2L2 Tchem Apoptosis regulator Bcl-W (121 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 472.55Molecular Weight (Monoisotopic): 472.2111AlogP: 4.96#Rotatable Bonds: 7
Polar Surface Area: 95.79Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 13.50CX Basic pKa: CX LogP: 4.73CX LogD: 4.73
Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.39Np Likeness Score: -1.80

References

1. Dömling A, Antuch W, Beck B, Schauer-Vukasinović V..  (2008)  Isosteric exchange of the acylsulfonamide moiety in Abbott's Bcl-XL protein interaction antagonist.,  18  (14): [PMID:18583128] [10.1016/j.bmcl.2008.05.096]

Source