2-(4-(2-(naphthalen-1-yloxy)ethoxy)benzyl)-3-hydroxynaphthalene-1,4-dione

ID: ALA482529

PubChem CID: 44586362

Max Phase: Preclinical

Molecular Formula: C29H22O5

Molecular Weight: 450.49

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C1C(O)=C(Cc2ccc(OCCOc3cccc4ccccc34)cc2)C(=O)c2ccccc21

Standard InChI:  InChI=1S/C29H22O5/c30-27-23-9-3-4-10-24(23)28(31)29(32)25(27)18-19-12-14-21(15-13-19)33-16-17-34-26-11-5-7-20-6-1-2-8-22(20)26/h1-15,32H,16-18H2

Standard InChI Key:  KHESBOVOQRNNIT-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 34 38  0  0  0  0  0  0  0  0999 V2000
    8.6013   -7.8329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6000   -8.6605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3130   -9.0733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3110   -7.4200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0292   -7.8289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0329   -8.6625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7527   -9.0738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4734   -8.6561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4697   -7.8224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7453   -7.4065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7552   -9.8988    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.7405   -6.5816    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.1892   -9.0664    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.1828   -7.4075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8987   -7.8176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8976   -8.6409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6127   -9.0509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3267   -8.6359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3212   -7.8066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6056   -7.4004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0431   -9.0450    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.7556   -8.6291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4720   -9.0381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1846   -8.6222    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.9010   -9.0313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3326   -9.8485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3260   -9.0192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6098   -8.6140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6191  -10.2644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9078   -9.8539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1987  -10.2645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1997  -11.0856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9157  -11.4942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6219  -11.0813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  4  1  1  0
 16 17  1  0
  5 10  1  0
 17 18  2  0
  6  7  1  0
 18 19  1  0
  7  8  1  0
 19 20  2  0
 20 15  1  0
  8  9  2  0
 18 21  1  0
  9 10  1  0
 21 22  1  0
  5  6  1  0
 22 23  1  0
  7 11  2  0
 23 24  1  0
 24 25  1  0
 25 30  2  0
 10 12  2  0
 29 26  2  0
  2  3  1  0
 26 27  1  0
  8 13  1  0
 27 28  2  0
 28 25  1  0
  3  6  2  0
  9 14  1  0
 29 30  1  0
  1  2  2  0
 30 31  1  0
 14 15  1  0
 31 32  2  0
  5  4  2  0
 32 33  1  0
 15 16  2  0
 33 34  2  0
 34 29  1  0
M  END

Associated Targets(non-human)

Pparg Peroxisome proliferator-activated receptor gamma (40 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 450.49Molecular Weight (Monoisotopic): 450.1467AlogP: 5.73#Rotatable Bonds: 7
Polar Surface Area: 72.83Molecular Species: ACIDHBA: 5HBD: 1
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 5.47CX Basic pKa: CX LogP: 5.43CX LogD: 3.50
Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.36Np Likeness Score: 0.03

References

1. Sundriyal S, Viswanad B, Bharathy E, Ramarao P, Chakraborti AK, Bharatam PV..  (2008)  New PPARgamma ligands based on 2-hydroxy-1,4-naphthoquinone: computer-aided design, synthesis, and receptor-binding studies.,  18  (11): [PMID:18482837] [10.1016/j.bmcl.2008.04.072]

Source