The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(4-(2-(naphthalen-1-yloxy)ethoxy)benzyl)-3-hydroxynaphthalene-1,4-dione ID: ALA482529
PubChem CID: 44586362
Max Phase: Preclinical
Molecular Formula: C29H22O5
Molecular Weight: 450.49
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C1C(O)=C(Cc2ccc(OCCOc3cccc4ccccc34)cc2)C(=O)c2ccccc21
Standard InChI: InChI=1S/C29H22O5/c30-27-23-9-3-4-10-24(23)28(31)29(32)25(27)18-19-12-14-21(15-13-19)33-16-17-34-26-11-5-7-20-6-1-2-8-22(20)26/h1-15,32H,16-18H2
Standard InChI Key: KHESBOVOQRNNIT-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
8.6013 -7.8329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6000 -8.6605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3130 -9.0733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3110 -7.4200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0292 -7.8289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0329 -8.6625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7527 -9.0738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4734 -8.6561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4697 -7.8224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7453 -7.4065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7552 -9.8988 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.7405 -6.5816 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.1892 -9.0664 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.1828 -7.4075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8987 -7.8176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8976 -8.6409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6127 -9.0509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3267 -8.6359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3212 -7.8066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6056 -7.4004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0431 -9.0450 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.7556 -8.6291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4720 -9.0381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1846 -8.6222 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.9010 -9.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3326 -9.8485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3260 -9.0192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6098 -8.6140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6191 -10.2644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9078 -9.8539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1987 -10.2645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1997 -11.0856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9157 -11.4942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6219 -11.0813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4 1 1 0
16 17 1 0
5 10 1 0
17 18 2 0
6 7 1 0
18 19 1 0
7 8 1 0
19 20 2 0
20 15 1 0
8 9 2 0
18 21 1 0
9 10 1 0
21 22 1 0
5 6 1 0
22 23 1 0
7 11 2 0
23 24 1 0
24 25 1 0
25 30 2 0
10 12 2 0
29 26 2 0
2 3 1 0
26 27 1 0
8 13 1 0
27 28 2 0
28 25 1 0
3 6 2 0
9 14 1 0
29 30 1 0
1 2 2 0
30 31 1 0
14 15 1 0
31 32 2 0
5 4 2 0
32 33 1 0
15 16 2 0
33 34 2 0
34 29 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 450.49Molecular Weight (Monoisotopic): 450.1467AlogP: 5.73#Rotatable Bonds: 7Polar Surface Area: 72.83Molecular Species: ACIDHBA: 5HBD: 1#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 5.47CX Basic pKa: ┄CX LogP: 5.43CX LogD: 3.50Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.36Np Likeness Score: 0.03
References 1. Sundriyal S, Viswanad B, Bharathy E, Ramarao P, Chakraborti AK, Bharatam PV.. (2008) New PPARgamma ligands based on 2-hydroxy-1,4-naphthoquinone: computer-aided design, synthesis, and receptor-binding studies., 18 (11): [PMID:18482837 ] [10.1016/j.bmcl.2008.04.072 ]