4alpha-phorbol diacetate

ID: ALA484343

Cas Number: 56144-62-8

PubChem CID: 452547

Max Phase: Preclinical

Molecular Formula: C24H32O8

Molecular Weight: 448.51

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Synonyms: 4Alpha-Phorbol Diacetate | 4alpha-Phorbol 12,13-diacetate|56144-62-8|4alpha-phorbol diacetate|4-alpha-Phorbol 12,13-diacetate|CHEMBL484343|[(1S,2S,6S,10S,11R,13S,14R,15R)-13-acetyloxy-1,6-dihydroxy-8-(hydroxymethyl)-4,12,12,15-tetramethyl-5-oxo-14-tetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dienyl] acetate|5H-Cyclopropa(3,4)benz(1,2-e)azulen-5-one, 9,9a-bis(acetyloxy)-1,1a,1b,4,4a,7a,7b,8,9,9a-decahydro-4a,7b-dihydroxy-3-(hydroxymethyl)-1,1,6,8-tetramethyl-, (1aR-(1aalpha,1bbeta,4aalpha,7aalpha,7Show More

Canonical SMILES:  CC(=O)O[C@@H]1[C@@H](C)[C@@]2(O)[C@@H](C=C(CO)C[C@@]3(O)C(=O)C(C)=C[C@@H]23)[C@@H]2C(C)(C)[C@]12OC(C)=O

Standard InChI:  InChI=1S/C24H32O8/c1-11-7-17-22(29,19(11)28)9-15(10-25)8-16-18-21(5,6)24(18,32-14(4)27)20(31-13(3)26)12(2)23(16,17)30/h7-8,12,16-18,20,25,29-30H,9-10H2,1-6H3/t12-,16+,17-,18-,20-,22+,23-,24-/m1/s1

Standard InChI Key:  OMHXSAMFEJVCPT-FGMNWAPQSA-N

Molfile:  

     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
   -1.0380  -10.4913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4260  -11.0295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6024  -11.0915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8748   -9.2635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1613   -9.6769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1604   -8.0306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8774   -8.4411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8895  -10.3453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6403   -9.5549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3149   -9.0737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9812   -9.5666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7181  -10.3524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5644   -8.8029    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4793  -10.1353    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3037  -11.8605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4883  -11.9863    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3083  -11.0542    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9292   -9.9667    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7680   -9.3186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1972  -11.0241    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1583   -7.2056    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5918   -8.0285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4469   -8.4440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4536   -9.2639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2598   -8.8597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1292   -9.8458    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0417   -7.7250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8717   -6.7912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8696   -5.9662    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7833   -7.7165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1884   -6.9978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2032   -8.4266    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.8417   -9.4417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0833   -8.8583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5872   -7.2019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 15 16  1  0
 23  6  1  0
  8 17  1  6
  6  7  1  0
  9 18  1  6
  8  9  1  0
 11 19  1  0
  1  3  2  0
 12 20  2  0
  2  3  1  0
  6 21  1  1
  4  5  1  0
  7 22  1  6
 24 23  1  0
 25 24  1  0
 23 25  1  0
  5  1  1  0
  9  4  1  0
  9 10  1  0
 10 11  2  0
 24 26  1  6
 11 12  1  0
 23 27  1  6
 12  8  1  0
 21 28  1  0
  8  2  1  0
 28 29  2  0
  4 13  1  6
 27 30  1  0
 30 31  1  0
  5 14  1  1
 30 32  2  0
  4  7  1  0
 25 33  1  0
  3 15  1  0
 25 34  1  0
  5 24  1  0
 28 35  1  0
M  END

Alternative Forms

Associated Targets(non-human)

Trpv4 Transient receptor potential cation channel subfamily V member 4 (46 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 448.51Molecular Weight (Monoisotopic): 448.2097AlogP: 1.07#Rotatable Bonds: 3
Polar Surface Area: 130.36Molecular Species: NEUTRALHBA: 8HBD: 3
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 12.57CX Basic pKa: CX LogP: 0.10CX LogD: 0.10
Aromatic Rings: Heavy Atoms: 32QED Weighted: 0.43Np Likeness Score: 3.21

References

1. Klausen TK, Pagani A, Minassi A, Ech-Chahad A, Prenen J, Owsianik G, Hoffmann EK, Pedersen SF, Appendino G, Nilius B..  (2009)  Modulation of the transient receptor potential vanilloid channel TRPV4 by 4alpha-phorbol esters: a structure-activity study.,  52  (9): [PMID:19361196] [10.1021/jm9001007]

Source