(R)-((4aR,5S)-1-(4-methoxyphenyl)-4a-methyl-4,4a,5,6,7,8-hexahydro-1H-benzo[f]indazol-5-yl)(phenyl)methanol

ID: ALA4845663

PubChem CID: 164609051

Max Phase: Preclinical

Molecular Formula: C26H28N2O2

Molecular Weight: 400.52

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(-n2ncc3c2C=C2CCC[C@H]([C@@H](O)c4ccccc4)[C@@]2(C)C3)cc1

Standard InChI:  InChI=1S/C26H28N2O2/c1-26-16-19-17-27-28(21-11-13-22(30-2)14-12-21)24(19)15-20(26)9-6-10-23(26)25(29)18-7-4-3-5-8-18/h3-5,7-8,11-15,17,23,25,29H,6,9-10,16H2,1-2H3/t23-,25+,26+/m1/s1

Standard InChI Key:  FCTQYCNGUCYSET-AFESJLNVSA-N

Molfile:  

 
     RDKit          2D

 31 35  0  0  0  0  0  0  0  0999 V2000
   26.0381   -4.7211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7518   -4.3142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7518   -3.4879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0381   -3.0685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3244   -4.3142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3269   -3.4897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6147   -3.0750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6137   -4.7222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9009   -4.3153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8998   -3.4916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1158   -3.2395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6351   -3.9033    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.1178   -4.5696    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.8687   -5.3551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0593   -5.5263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8062   -6.3118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3576   -6.9271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1692   -6.7514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4226   -5.9661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0366   -2.2422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7521   -1.8299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3198   -1.8323    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.9201   -2.7642    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   22.1039   -7.7091    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.4642   -2.2442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1792   -1.8326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1802   -1.0060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4604   -0.5927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7484   -1.0067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6544   -8.3198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3269   -2.6647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  6  4  1  0
  5  1  1  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  5  6  1  0
  6  7  1  0
  7 10  1  0
  9  8  1  0
  8  5  2  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13  9  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 13 14  1  0
  4 20  1  0
 20 21  1  0
 20 22  1  1
  4 23  1  6
 17 24  1  0
 21 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 21  1  0
 24 30  1  0
  6 31  1  1
M  END

Alternative Forms

  1. Parent:

    ALA4845663

    ---

Associated Targets(non-human)

Nr3c1 Glucocorticoid receptor (1330 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 400.52Molecular Weight (Monoisotopic): 400.2151AlogP: 5.36#Rotatable Bonds: 4
Polar Surface Area: 47.28Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 1.60CX LogP: 4.96CX LogD: 4.96
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.64Np Likeness Score: 0.09

References

1. Kennedy BJ, Lato AM, Fisch AR, Burke SJ, Kirkland JK, Prevatte CW, Dunlap LE, Smith RT, Vogiatzis KD, Collier JJ, Campagna SR..  (2021)  Potent Anti-Inflammatory, Arylpyrazole-Based Glucocorticoid Receptor Agonists That Do Not Impair Insulin Secretion.,  12  (10.0): [PMID:34676039] [10.1021/acsmedchemlett.1c00379]

Source